Tetrabutyl 2-(2,6-di-tert-butylpyridin-4-yl)ethan-1,1-bisphosphonate

ID: ALA5289887

Max Phase: Preclinical

Molecular Formula: C31H59NO6P2

Molecular Weight: 603.76

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCOP(=O)(OCCCC)C(Cc1cc(C(C)(C)C)nc(C(C)(C)C)c1)P(=O)(OCCCC)OCCCC

Standard InChI:  InChI=1S/C31H59NO6P2/c1-11-15-19-35-39(33,36-20-16-12-2)29(40(34,37-21-17-13-3)38-22-18-14-4)25-26-23-27(30(5,6)7)32-28(24-26)31(8,9)10/h23-24,29H,11-22,25H2,1-10H3

Standard InChI Key:  RWGZCBBEHPOZPX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 40  0  0  0  0  0  0  0  0999 V2000
   -4.2854    0.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5709    0.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5709    1.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2854    0.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8564    0.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8564   -0.8159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1402   -1.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1402   -2.0489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1402   -2.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8546   -2.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257   -2.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4302   -0.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4302    0.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7158    0.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013    0.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013   -0.8123    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2158   -1.6089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0128   -1.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2273   -2.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6445   -3.2021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8590   -3.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7996   -1.0261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7130   -1.2246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7130   -2.0497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4275   -2.4622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4275   -3.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1420   -3.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7130    0.4251    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.3014    1.1409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1262    1.1409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138    1.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1262    2.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138    3.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1262    3.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4275    0.0127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1420    0.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8564    0.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5709    0.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2854    0.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420    0.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  2  4  1  0
  5  2  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
  7 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16 22  2  0
 16 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 15 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 28 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 13 40  1  0
 40  5  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5289887

    ---

Associated Targets(Human)

HMGCR Tclin HMG-CoA reductase (2475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 603.76Molecular Weight (Monoisotopic): 603.3818AlogP: 10.20#Rotatable Bonds: 20
Polar Surface Area: 83.95Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.43CX LogP: 9.54CX LogD: 9.54
Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.11Np Likeness Score: -0.10

References

1. Kawamura K, Yoshioka H, Sato C, Yajima T, Furuyama Y, Kuramochi K, Ohgane K..  (2023)  Fine-tuning of nitrogen-containing bisphosphonate esters that potently induce degradation of HMG-CoA reductase.,  78  [PMID:36580745] [10.1016/j.bmc.2022.117145]

Source