The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((Benzene-1,3,5-triyltris(oxy))tris(benzene-4,1-diyl))trimethanamine ID: ALA5289898
Max Phase: Preclinical
Molecular Formula: C27H27N3O3
Molecular Weight: 441.53
Associated Items:
Names and Identifiers Canonical SMILES: NCc1ccc(Oc2cc(Oc3ccc(CN)cc3)cc(Oc3ccc(CN)cc3)c2)cc1
Standard InChI: InChI=1S/C27H27N3O3/c28-16-19-1-7-22(8-2-19)31-25-13-26(32-23-9-3-20(17-29)4-10-23)15-27(14-25)33-24-11-5-21(18-30)6-12-24/h1-15H,16-18,28-30H2
Standard InChI Key: VVUGURQNNBZXSZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-1.0699 1.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3554 2.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3564 1.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3564 0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3536 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0699 0.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0711 2.0618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7857 1.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7846 2.0613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4993 1.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3536 -0.4129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3609 -0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5004 2.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2126 1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2126 0.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5023 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7857 0.8205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4995 0.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2124 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9272 0.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9288 1.6467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2169 2.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0757 -0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7879 -0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7879 -1.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0776 -2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3609 -1.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6418 0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6418 -0.4121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5025 -2.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2171 -1.6506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9272 0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6418 0.8242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 1 0
1 9 1 0
9 10 1 0
5 11 1 0
11 12 1 0
13 8 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
8 17 1 0
18 10 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
10 22 1 0
23 12 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
12 27 1 0
20 28 1 0
28 29 1 0
25 30 1 0
30 31 1 0
15 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.53Molecular Weight (Monoisotopic): 441.2052AlogP: 5.44#Rotatable Bonds: 9Polar Surface Area: 105.75Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.74CX LogP: 3.85CX LogD: -1.67Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -0.09
References 1. Hammerschmidt SJ, Maus H, Weldert AC, Gütschow M, Kersten C.. (2023) Improving binding entropy by higher ligand symmetry? - A case study with human matriptase., 14 (5): [PMID:37252099 ] [10.1039/d3md00125c ]