((Benzene-1,3,5-triyltris(oxy))tris(benzene-4,1-diyl))trimethanamine

ID: ALA5289898

Max Phase: Preclinical

Molecular Formula: C27H27N3O3

Molecular Weight: 441.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCc1ccc(Oc2cc(Oc3ccc(CN)cc3)cc(Oc3ccc(CN)cc3)c2)cc1

Standard InChI:  InChI=1S/C27H27N3O3/c28-16-19-1-7-22(8-2-19)31-25-13-26(32-23-9-3-20(17-29)4-10-23)15-27(14-25)33-24-11-5-21(18-30)6-12-24/h1-15H,16-18,28-30H2

Standard InChI Key:  VVUGURQNNBZXSZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -1.0699    1.6488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3554    2.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3564    1.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3564    0.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3536    0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0699    0.8202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0711    2.0618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7857    1.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7846    2.0613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4993    1.6488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3536   -0.4129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3609   -0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5004    2.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2126    1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2126    0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5023    0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7857    0.8205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4995    0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2124    0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9272    0.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9288    1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2169    2.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0757   -0.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7879   -0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7879   -1.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0776   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3609   -1.6543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6418    0.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6418   -0.4121    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5025   -2.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2171   -1.6506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9272    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6418    0.8242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  7  8  1  0
  1  9  1  0
  9 10  1  0
  5 11  1  0
 11 12  1  0
 13  8  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
  8 17  1  0
 18 10  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 10 22  1  0
 23 12  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 12 27  1  0
 20 28  1  0
 28 29  1  0
 25 30  1  0
 30 31  1  0
 15 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5289898

    ---

Associated Targets(Human)

ST14 Tchem Matriptase (677 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.53Molecular Weight (Monoisotopic): 441.2052AlogP: 5.44#Rotatable Bonds: 9
Polar Surface Area: 105.75Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.74CX LogP: 3.85CX LogD: -1.67
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -0.09

References

1. Hammerschmidt SJ, Maus H, Weldert AC, Gütschow M, Kersten C..  (2023)  Improving binding entropy by higher ligand symmetry? - A case study with human matriptase.,  14  (5): [PMID:37252099] [10.1039/d3md00125c]

Source