3-((R)-4-((5S,8R,9S,10S,13R,14S,17R)-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamido)propanoic acid

ID: ALA5289923

Max Phase: Preclinical

Molecular Formula: C27H45NO3

Molecular Weight: 431.66

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](CCC(=O)NCCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C27H45NO3/c1-18(7-12-24(29)28-17-14-25(30)31)21-10-11-22-20-9-8-19-6-4-5-15-26(19,2)23(20)13-16-27(21,22)3/h18-23H,4-17H2,1-3H3,(H,28,29)(H,30,31)/t18-,19+,20+,21-,22+,23+,26+,27-/m1/s1

Standard InChI Key:  DTYKJLVQRZFITH-DPXZQEIRSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -3.6164   -2.2894    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6164   -1.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3307   -1.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0449   -1.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0449   -0.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3307   -0.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6164   -0.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6164    0.1851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9023   -0.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9023   -1.0524    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1880   -0.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1880   -1.4645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9023   -1.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1880    0.1851    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4737   -0.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3875   -1.0478    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4737    0.5972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1879    1.0096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9022    0.5972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3874    1.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6893    0.8520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4759    1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0592    2.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3209    1.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9043    1.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2046    0.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6895   -0.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1217    1.0023    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7012    1.4926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2845    0.9092    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9146    2.2894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0814    1.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6647    0.5394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4615    0.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0449    0.1696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6751    1.5497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  3  2  1  0
  4  3  1  0
  5  4  1  0
  5  6  1  0
  2  7  1  0
  7  6  1  0
  7  8  1  1
  7  9  1  0
  9 10  1  6
 11  9  1  0
 12 11  1  0
  2 13  1  0
 13 12  1  0
 11 14  1  1
 11 15  1  0
 15 16  1  6
 15 17  1  0
 17 18  1  0
  9 19  1  0
 18 19  1  0
 17 20  1  1
 17 21  1  0
 21 22  1  0
 22 23  1  6
 22 24  1  0
 24 25  1  0
 21 26  1  0
 15 27  1  0
 26 27  1  0
 21 28  1  6
 25 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5289923

    ---

Associated Targets(Human)

EPHA2 Tclin Ephrin type-A receptor 2 (3499 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.66Molecular Weight (Monoisotopic): 431.3399AlogP: 6.04#Rotatable Bonds: 7
Polar Surface Area: 66.40Molecular Species: ACIDHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.37CX Basic pKa: CX LogP: 5.54CX LogD: 2.63
Aromatic Rings: Heavy Atoms: 31QED Weighted: 0.52Np Likeness Score: 1.52

References

1. Singla P, Salunke DB..  (2020)  Recent advances in steroid amino acid conjugates: Old scaffolds with new dimensions.,  187  [PMID:31830636] [10.1016/j.ejmech.2019.111909]

Source