The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((R)-4-((5S,8R,9S,10S,13R,14S,17R)-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamido)propanoic acid ID: ALA5289923
Max Phase: Preclinical
Molecular Formula: C27H45NO3
Molecular Weight: 431.66
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](CCC(=O)NCCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C27H45NO3/c1-18(7-12-24(29)28-17-14-25(30)31)21-10-11-22-20-9-8-19-6-4-5-15-26(19,2)23(20)13-16-27(21,22)3/h18-23H,4-17H2,1-3H3,(H,28,29)(H,30,31)/t18-,19+,20+,21-,22+,23+,26+,27-/m1/s1
Standard InChI Key: DTYKJLVQRZFITH-DPXZQEIRSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-3.6164 -2.2894 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.6164 -1.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3307 -1.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0449 -1.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0449 -0.6397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3307 -0.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6164 -0.6397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6164 0.1851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9023 -0.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9023 -1.0524 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.1880 -0.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1880 -1.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9023 -1.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1880 0.1851 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4737 -0.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3875 -1.0478 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4737 0.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1879 1.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9022 0.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3874 1.4177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6893 0.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4759 1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0592 2.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3209 1.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9043 1.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2046 0.1847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6895 -0.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1217 1.0023 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.7012 1.4926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2845 0.9092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9146 2.2894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0814 1.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6647 0.5394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4615 0.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0449 0.1696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6751 1.5497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
3 2 1 0
4 3 1 0
5 4 1 0
5 6 1 0
2 7 1 0
7 6 1 0
7 8 1 1
7 9 1 0
9 10 1 6
11 9 1 0
12 11 1 0
2 13 1 0
13 12 1 0
11 14 1 1
11 15 1 0
15 16 1 6
15 17 1 0
17 18 1 0
9 19 1 0
18 19 1 0
17 20 1 1
17 21 1 0
21 22 1 0
22 23 1 6
22 24 1 0
24 25 1 0
21 26 1 0
15 27 1 0
26 27 1 0
21 28 1 6
25 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.66Molecular Weight (Monoisotopic): 431.3399AlogP: 6.04#Rotatable Bonds: 7Polar Surface Area: 66.40Molecular Species: ACIDHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.37CX Basic pKa: ┄CX LogP: 5.54CX LogD: 2.63Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.52Np Likeness Score: 1.52