(3S,6R)-3,4-dimethyl-6-pentylmorpholine-2,5-dione

ID: ALA5290003

Max Phase: Preclinical

Molecular Formula: C11H19NO3

Molecular Weight: 213.28

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCC[C@H]1OC(=O)[C@H](C)N(C)C1=O

Standard InChI:  InChI=1S/C11H19NO3/c1-4-5-6-7-9-10(13)12(3)8(2)11(14)15-9/h8-9H,4-7H2,1-3H3/t8-,9+/m0/s1

Standard InChI Key:  VJZCXZGOQMPVDZ-DTWKUNHWSA-N

Molfile:  

 
     RDKit          2D

 15 15  0  0  0  0  0  0  0  0999 V2000
    0.7144    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7144   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4290   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1436   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8582   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1436   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8581   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1436    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8582    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290    0.4124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  1  6
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9  3  1  0
 10  9  1  0
 10 11  2  0
 12 10  1  0
 12 13  1  1
 14 12  1  0
  1 14  1  0
 14 15  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290003

    ---

Associated Targets(non-human)

Ryr2 Ryanodine receptor 2 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 213.28Molecular Weight (Monoisotopic): 213.1365AlogP: 1.34#Rotatable Bonds: 4
Polar Surface Area: 46.61Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.74CX LogD: 1.74
Aromatic Rings: Heavy Atoms: 15QED Weighted: 0.52Np Likeness Score: 1.70

References

1. Smith AN, Blackwell DJ, Knollmann BC, Johnston JN..  (2021)  Ring Size as an Independent Variable in Cyclooligomeric Depsipeptide Antiarrhythmic Activity.,  12  (12.0): [PMID:34917258] [10.1021/acsmedchemlett.1c00508]

Source