N-(4-isopropoxypyridin-3-yl)-2-phenylimidazo[1,2-b]pyridazine-8-carboxamide

ID: ALA5290040

Max Phase: Preclinical

Molecular Formula: C21H19N5O2

Molecular Weight: 373.42

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)Oc1ccncc1NC(=O)c1ccnn2cc(-c3ccccc3)nc12

Standard InChI:  InChI=1S/C21H19N5O2/c1-14(2)28-19-9-10-22-12-17(19)25-21(27)16-8-11-23-26-13-18(24-20(16)26)15-6-4-3-5-7-15/h3-14H,1-2H3,(H,25,27)

Standard InChI Key:  GSXIRUIKNXNLAP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    0.6274    1.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0835    1.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0835    2.2797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7947    1.0248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5059    1.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2588    1.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2588    0.2300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5059   -0.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7947    0.2300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5059   -1.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2588   -1.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2588   -2.2797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5059   -2.6980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7947   -2.2797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4601   -1.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.1921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7947   -1.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2967   -1.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7150   -1.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5516   -1.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9699   -1.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5516   -2.5726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7150   -2.5726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9699    1.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9699    2.2797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2588    2.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5059    2.2797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 10 18  1  0
 14 18  1  0
 16 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 19 24  1  0
  6 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
  5 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290040

    ---

Associated Targets(Human)

GSK3A Tclin Glycogen synthase kinase-3 alpha (3764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MAPT Tclin Microtubule-associated protein tau (95507 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 373.42Molecular Weight (Monoisotopic): 373.1539AlogP: 3.83#Rotatable Bonds: 5
Polar Surface Area: 81.41Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.82CX LogP: 3.18CX LogD: 3.17
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.57Np Likeness Score: -1.81

References

1. Hartz RA, Ahuja VT, Sivaprakasam P, Xiao H, Krause CM, Clarke WJ, Kish K, Lewis H, Szapiel N, Ravirala R, Mutalik S, Nakmode D, Shah D, Burton CR, Macor JE, Dubowchik GM..  (2023)  Design, Structure-Activity Relationships, and In Vivo Evaluation of Potent and Brain-Penetrant Imidazo[1,2-b]pyridazines as Glycogen Synthase Kinase-3β (GSK-3β) Inhibitors.,  66  (6): [PMID:36950863] [10.1021/acs.jmedchem.3c00133]

Source