3-{2-[5-(2-chloroquinolin-3-yl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-1,3-thiazol-4-yl}-6-iodo-2H-chromen-2-one

ID: ALA5290092

Max Phase: Preclinical

Molecular Formula: C30H17ClFIN4O2S

Molecular Weight: 678.91

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1oc2ccc(I)cc2cc1-c1csc(N2N=C(c3ccccc3F)CC2c2cc3ccccc3nc2Cl)n1

Standard InChI:  InChI=1S/C30H17ClFIN4O2S/c31-28-21(12-16-5-1-4-8-23(16)34-28)26-14-24(19-6-2-3-7-22(19)32)36-37(26)30-35-25(15-40-30)20-13-17-11-18(33)9-10-27(17)39-29(20)38/h1-13,15,26H,14H2

Standard InChI Key:  OOUKJCDJVHDJQS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 46  0  0  0  0  0  0  0  0999 V2000
    1.0814   -0.3676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9064   -0.3676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1565   -1.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5029   -1.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8355   -1.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9532   -1.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6689    0.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1557    0.3466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4058    1.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2475    1.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9147    1.1291    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5367   -0.8020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3308   -1.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5443   -1.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9651   -2.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1676   -2.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2025    1.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857    0.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5824    0.9941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7958    1.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2127    2.3740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4160    2.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1642    0.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9611    0.6263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1753    1.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5960    2.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8327    2.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0388   -1.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1748   -2.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9693   -2.3727    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5527   -1.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3418   -0.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5468   -0.7781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3427   -2.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9245   -1.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7164   -0.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9259   -0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4083   -2.7438    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.5443    0.0431    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
    3.3232   -0.0053    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  1  5  1  0
  5  4  1  0
  3  6  1  0
  1  7  1  0
  8  7  2  0
  8  9  1  0
  9 10  2  0
 11 10  1  0
  7 11  1  0
 12  6  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
  6 16  1  0
  9 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  1  0
 17 22  1  0
 19 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 20 26  1  0
 22 27  2  0
  5 28  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 28 33  1  0
 31 34  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 32 37  1  0
 29 38  1  0
 24 39  1  0
 12 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290092

    ---

Associated Targets(non-human)

Bordetella bronchiseptica (483 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 678.91Molecular Weight (Monoisotopic): 677.9790AlogP: 8.22#Rotatable Bonds: 4
Polar Surface Area: 71.59Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 3.05CX LogP: 8.68CX LogD: 8.68
Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.11Np Likeness Score: -1.45

References

1. Nehra B, Rulhania S, Jaswal S, Kumar B, Singh G, Monga V..  (2020)  Recent advancements in the development of bioactive pyrazoline derivatives.,  205  [PMID:32795767] [10.1016/j.ejmech.2020.112666]

Source