Isobrasiliensic acid

ID: ALA5290146

Max Phase: Preclinical

Molecular Formula: C32H46O6

Molecular Weight: 526.71

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(C)C(CC=C(C)C)CC1(CC=C(C)C)C(=O)C(C(CCC)CC(=O)O)=C2O[C@H](C)[C@@H](C)C(=O)C2=C1O

Standard InChI:  InChI=1S/C32H46O6/c1-10-11-23(16-25(33)34)26-29-27(28(35)21(8)22(9)38-29)31(37)32(30(26)36,15-14-19(4)5)17-24(20(6)7)13-12-18(2)3/h12,14,21-24,37H,6,10-11,13,15-17H2,1-5,7-9H3,(H,33,34)/t21-,22-,23?,24?,32?/m1/s1

Standard InChI Key:  JOTAXNOOGLJFBN-LUSGHDGPSA-N

Molfile:  

 
     RDKit          2D

 38 39  0  0  0  0  0  0  0  0999 V2000
   -1.1664   -1.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7539   -1.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0710   -1.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1664   -0.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9913   -0.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4039   -1.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2288   -1.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6413   -0.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6413   -1.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7539    0.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0718    0.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3414    1.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0710    1.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3414    2.5707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1664    2.5707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0710    3.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0718   -0.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6426   -0.8147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7880   -0.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7880   -1.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0735   -2.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0735   -2.8727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7880   -3.2852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6408   -3.2852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5024   -2.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2169   -1.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9314   -2.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4979   -0.3985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2124   -0.8110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9269   -0.3985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6413   -0.8111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9269    0.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6413    0.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2124    0.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2124    1.6638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4979    0.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7862    0.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7862    1.6631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  4  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
 10  4  1  0
 11 10  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 11 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 19 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  1
 30 32  1  0
 32 33  1  6
 32 34  1  0
 34 35  2  0
 36 34  1  0
 28 36  1  0
 36 37  2  0
 37 11  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290146

    ---

Associated Targets(non-human)

Helicobacter pylori (3113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.71Molecular Weight (Monoisotopic): 526.3294AlogP: 7.43#Rotatable Bonds: 12
Polar Surface Area: 100.90Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.26CX Basic pKa: CX LogP: 6.79CX LogD: 3.79
Aromatic Rings: Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: 2.63

References

1. Ghobadi E, Ghanbarimasir Z, Emami S..  (2021)  A review on the structures and biological activities of anti-Helicobacter pylori agents.,  223  [PMID:34218084] [10.1016/j.ejmech.2021.113669]

Source