The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Isobrasiliensic acid ID: ALA5290146
Max Phase: Preclinical
Molecular Formula: C32H46O6
Molecular Weight: 526.71
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)C(CC=C(C)C)CC1(CC=C(C)C)C(=O)C(C(CCC)CC(=O)O)=C2O[C@H](C)[C@@H](C)C(=O)C2=C1O
Standard InChI: InChI=1S/C32H46O6/c1-10-11-23(16-25(33)34)26-29-27(28(35)21(8)22(9)38-29)31(37)32(30(26)36,15-14-19(4)5)17-24(20(6)7)13-12-18(2)3/h12,14,21-24,37H,6,10-11,13,15-17H2,1-5,7-9H3,(H,33,34)/t21-,22-,23?,24?,32?/m1/s1
Standard InChI Key: JOTAXNOOGLJFBN-LUSGHDGPSA-N
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
-1.1664 -1.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7539 -1.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0710 -1.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1664 -0.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9913 -0.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4039 -1.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2288 -1.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6413 -0.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6413 -1.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7539 0.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0718 0.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3414 1.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0710 1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3414 2.5707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1664 2.5707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0710 3.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0718 -0.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6426 -0.8147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7880 -0.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7880 -1.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0735 -2.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0735 -2.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7880 -3.2852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6408 -3.2852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5024 -2.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2169 -1.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9314 -2.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4979 -0.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2124 -0.8110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9269 -0.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6413 -0.8111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9269 0.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6413 0.8388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2124 0.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2124 1.6638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4979 0.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7862 0.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7862 1.6631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
4 2 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
7 9 1 0
10 4 1 0
11 10 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
14 16 1 0
11 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
20 25 1 0
25 26 1 0
26 27 1 0
19 28 2 0
28 29 1 0
29 30 1 0
30 31 1 1
30 32 1 0
32 33 1 6
32 34 1 0
34 35 2 0
36 34 1 0
28 36 1 0
36 37 2 0
37 11 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.71Molecular Weight (Monoisotopic): 526.3294AlogP: 7.43#Rotatable Bonds: 12Polar Surface Area: 100.90Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.26CX Basic pKa: ┄CX LogP: 6.79CX LogD: 3.79Aromatic Rings: ┄Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: 2.63
References 1. Ghobadi E, Ghanbarimasir Z, Emami S.. (2021) A review on the structures and biological activities of anti-Helicobacter pylori agents., 223 [PMID:34218084 ] [10.1016/j.ejmech.2021.113669 ]