The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dendrillic acid B ID: ALA5290176
Max Phase: Preclinical
Molecular Formula: C21H27NO5
Molecular Weight: 373.45
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1c2c([C@@]3(C)CCCC(C)(C)C3)ccc(C(=O)O)c2C(=O)N1CC(=O)O
Standard InChI: InChI=1S/C21H27NO5/c1-12-16-14(21(4)9-5-8-20(2,3)11-21)7-6-13(19(26)27)17(16)18(25)22(12)10-15(23)24/h6-7,12H,5,8-11H2,1-4H3,(H,23,24)(H,26,27)/t12-,21-/m0/s1
Standard InChI Key: GSUIBTCHWHWBNN-QKVFXAPYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
-2.7531 -0.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0386 0.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3241 -0.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3241 -0.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0386 -1.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7531 -0.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6099 0.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6097 1.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1027 1.5699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8173 1.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8188 0.3368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1073 -0.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2834 -0.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4345 -0.2111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1036 -0.9660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5159 -1.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3407 -1.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7531 -2.3945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7531 -0.9660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2311 0.0023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5315 1.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5315 2.3945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2457 1.1575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3241 0.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4517 -2.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6270 -2.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2997 -1.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
7 3 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
7 12 1 0
12 11 2 0
12 13 1 0
11 14 1 0
14 15 1 0
15 13 1 0
15 16 1 0
16 17 1 0
17 18 2 0
17 19 1 0
14 20 2 0
10 21 1 0
21 22 2 0
21 23 1 0
3 24 1 1
5 25 1 0
5 26 1 0
13 27 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 373.45Molecular Weight (Monoisotopic): 373.1889AlogP: 3.84#Rotatable Bonds: 4Polar Surface Area: 94.91Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.20CX Basic pKa: ┄CX LogP: 3.58CX LogD: -2.98Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.84Np Likeness Score: 0.91
References 1. Sala S, James PJC, Nealon GL, Fromont J, Gomez O, Vuong D, Lacey E, Flematti GR.. (2023) Dendrillic Acids A and B: Nitrogenous, Rearranged Spongian Nor-Diterpenes from a Dendrilla sp. Marine Sponge., 86 (3): [PMID:36926864 ] [10.1021/acs.jnatprod.2c01087 ]