The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4S)-2-(4-(2-((R)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-6-yl)ethyl)benzamido)-4-fluoropentanedioic acid ID: ALA5290206
Max Phase: Preclinical
Molecular Formula: C21H24FN5O6
Molecular Weight: 461.45
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc2c(c(=O)[nH]1)C[C@@H](CCc1ccc(C(=O)N[C@@H](C[C@H](F)C(=O)O)C(=O)O)cc1)CN2
Standard InChI: InChI=1S/C21H24FN5O6/c22-14(19(30)31)8-15(20(32)33)25-17(28)12-5-3-10(4-6-12)1-2-11-7-13-16(24-9-11)26-21(23)27-18(13)29/h3-6,11,14-15H,1-2,7-9H2,(H,25,28)(H,30,31)(H,32,33)(H4,23,24,26,27,29)/t11-,14+,15+/m1/s1
Standard InChI Key: VQHFOTFSIAHMRV-UGFHNGPFSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
-0.3712 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3712 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3437 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0587 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0587 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3437 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7737 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4887 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2037 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2037 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9187 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4887 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9187 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6337 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6337 1.6500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3487 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0637 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3487 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7737 1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0862 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8012 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4887 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2037 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9187 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6337 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6337 0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3487 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.3487 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6337 -2.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9187 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2037 -2.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4887 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0637 -2.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 6
10 11 1 0
10 12 2 0
9 13 1 0
13 14 1 0
14 15 1 6
14 16 1 0
16 17 1 0
16 18 2 0
7 19 2 0
20 2 1 0
21 20 1 0
22 21 1 1
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
28 27 1 0
28 29 2 0
29 30 1 0
30 24 2 0
30 31 1 0
31 32 1 0
32 22 1 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.45Molecular Weight (Monoisotopic): 461.1711AlogP: 0.56#Rotatable Bonds: 9Polar Surface Area: 187.50Molecular Species: ACIDHBA: 7HBD: 6#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.26CX Basic pKa: ┄CX LogP: 0.62CX LogD: -6.12Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: 0.08
References 1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B.. (2018) An overview of quinazolines: Pharmacological significance and recent developments., 151 [PMID:29656203 ] [10.1016/j.ejmech.2018.03.076 ]