(2S,4S)-2-(4-(2-((R)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-6-yl)ethyl)benzamido)-4-fluoropentanedioic acid

ID: ALA5290206

Max Phase: Preclinical

Molecular Formula: C21H24FN5O6

Molecular Weight: 461.45

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc2c(c(=O)[nH]1)C[C@@H](CCc1ccc(C(=O)N[C@@H](C[C@H](F)C(=O)O)C(=O)O)cc1)CN2

Standard InChI:  InChI=1S/C21H24FN5O6/c22-14(19(30)31)8-15(20(32)33)25-17(28)12-5-3-10(4-6-12)1-2-11-7-13-16(24-9-11)26-21(23)27-18(13)29/h3-6,11,14-15H,1-2,7-9H2,(H,25,28)(H,30,31)(H,32,33)(H4,23,24,26,27,29)/t11-,14+,15+/m1/s1

Standard InChI Key:  VQHFOTFSIAHMRV-UGFHNGPFSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   -0.3712    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3712   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3437   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0587   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0587    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3437    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7737    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4887    0.4125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2037    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2037    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9187    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4887    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9187    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6337    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6337    1.6500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.3487    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0637    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3487   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7737    1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0862   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8012   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4887   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2037   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9187   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6337   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6337    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3487   -0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3487   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6337   -2.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9187   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2037   -2.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4887   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0637   -2.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  6
 10 11  1  0
 10 12  2  0
  9 13  1  0
 13 14  1  0
 14 15  1  6
 14 16  1  0
 16 17  1  0
 16 18  2  0
  7 19  2  0
 20  2  1  0
 21 20  1  0
 22 21  1  1
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 28 27  1  0
 28 29  2  0
 29 30  1  0
 30 24  2  0
 30 31  1  0
 31 32  1  0
 32 22  1  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290206

    ---

Associated Targets(Human)

Homo sapiens (32628 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.45Molecular Weight (Monoisotopic): 461.1711AlogP: 0.56#Rotatable Bonds: 9
Polar Surface Area: 187.50Molecular Species: ACIDHBA: 7HBD: 6
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.26CX Basic pKa: CX LogP: 0.62CX LogD: -6.12
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: 0.08

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source