N-(4-(hydroxymethyl)phenyl)-6-methoxybenzo[d]thiazole-2-carboxamide

ID: ALA5290220

Max Phase: Preclinical

Molecular Formula: C16H14N2O3S

Molecular Weight: 314.37

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc2nc(C(=O)Nc3ccc(CO)cc3)sc2c1

Standard InChI:  InChI=1S/C16H14N2O3S/c1-21-12-6-7-13-14(8-12)22-16(18-13)15(20)17-11-4-2-10(9-19)3-5-11/h2-8,19H,9H2,1H3,(H,17,20)

Standard InChI Key:  UNSXISUMFIZGPQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   -3.4653    0.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7507    0.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0388    0.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0388   -0.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7489   -0.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4653   -0.3037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1799   -0.7164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1799   -1.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2541   -0.5550    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7691    0.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2541    0.7799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0561    0.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4686    0.8270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4686   -0.6022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2938    0.8270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7067    1.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5294    1.5408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9421    0.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5329    0.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7082    0.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7673    0.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1799    1.5406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  4  9  1  0
 10  9  1  0
 11 10  2  0
  3 11  1  0
 12 10  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 18 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290220

    ---

Associated Targets(Human)

MAPT Tclin Microtubule-associated protein tau (95507 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 314.37Molecular Weight (Monoisotopic): 314.0725AlogP: 3.05#Rotatable Bonds: 4
Polar Surface Area: 71.45Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.59CX Basic pKa: CX LogP: 2.66CX LogD: 2.66
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.78Np Likeness Score: -1.59

References

1. Wongso H, Ono M, Yamasaki T, Kumata K, Higuchi M, Zhang MR, Fulham MJ, Katsifis A, Keller PA..  (2023)  Synthesis and structure-activity relationship (SAR) studies of 1,2,3-triazole, amide, and ester-based benzothiazole derivatives as potential molecular probes for tau protein.,  14  (5): [PMID:37252097] [10.1039/d2md00358a]

Source