The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2Z)-2-{[1-(2-ethylphenyl)-3-(5-methoxy-1-methyl-1H-indol-3-yl)-1H-pyrazol-5-yl]imino}-1,3-thiazolidin-4-one ID: ALA5290235
Max Phase: Preclinical
Molecular Formula: C24H23N5O2S
Molecular Weight: 445.55
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccccc1-n1nc(-c2cn(C)c3ccc(OC)cc23)cc1/N=C1/NC(=O)CS1
Standard InChI: InChI=1S/C24H23N5O2S/c1-4-15-7-5-6-8-20(15)29-22(25-24-26-23(30)14-32-24)12-19(27-29)18-13-28(2)21-10-9-16(31-3)11-17(18)21/h5-13H,4,14H2,1-3H3,(H,25,26,30)
Standard InChI Key: SHWWMPNWAHEXIQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
0.0065 0.5702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8315 0.5702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0816 -0.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4281 -0.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2392 -0.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8782 -0.4471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0916 -1.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8883 -1.4572 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9217 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1690 -2.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6518 -1.9360 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.6360 -2.7106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0359 -0.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2493 -1.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0904 -1.2560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3758 -0.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7281 0.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1449 -0.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2693 0.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6260 1.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8529 0.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2438 1.2845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8316 1.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2435 2.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0684 2.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4801 2.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0721 1.2845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8395 1.9310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6360 2.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5027 -1.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4845 0.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3092 0.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
1 5 2 0
5 4 1 0
3 6 1 0
6 7 2 0
8 7 1 0
8 9 1 0
9 10 1 0
11 10 1 0
7 11 1 0
9 12 2 0
5 13 1 0
14 13 2 0
14 15 1 0
15 16 1 0
17 16 2 0
13 17 1 0
16 18 1 0
19 18 2 0
20 19 1 0
21 20 2 0
17 21 1 0
2 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
20 28 1 0
28 29 1 0
15 30 1 0
27 31 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.55Molecular Weight (Monoisotopic): 445.1572AlogP: 4.45#Rotatable Bonds: 5Polar Surface Area: 73.44Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.57CX Basic pKa: 0.88CX LogP: 5.11CX LogD: 4.89Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: -0.99
References 1. Soni JP, Chilvery S, Sharma A, Reddy GN, Godugu C, Shankaraiah N.. (2023) Design, synthesis and in vitro cytotoxicity evaluation of indolo-pyrazoles grafted with thiazolidinone as tubulin polymerization inhibitors., 14 (3): [PMID:36970141 ] [10.1039/d2md00442a ]