2-(7-methoxy-2-oxo-2H-chromen-4-yl)-9,9-dimethyl-12-phenyl-9,10-dihydro-8H-chromeno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidin-11(12H)-one

ID: ALA5290276

Max Phase: Preclinical

Molecular Formula: C30H24N4O5

Molecular Weight: 520.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c(-c3nc4c5c(ncn4n3)OC3=C(C(=O)CC(C)(C)C3)C5c3ccccc3)cc(=O)oc2c1

Standard InChI:  InChI=1S/C30H24N4O5/c1-30(2)13-20(35)25-22(14-30)39-29-26(24(25)16-7-5-4-6-8-16)28-32-27(33-34(28)15-31-29)19-12-23(36)38-21-11-17(37-3)9-10-18(19)21/h4-12,15,24H,13-14H2,1-3H3

Standard InChI Key:  CFZJVKWJMJLSDX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 45  0  0  0  0  0  0  0  0999 V2000
    0.6335   -0.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9690   -0.7606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559   -1.3126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559   -2.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3584   -2.5501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0729   -2.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0729   -1.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3584   -0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1868   -0.0931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7874   -0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7874   -0.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0696    0.3396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0696    1.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7864    1.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5013    1.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5013    0.3381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5019   -1.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5019   -2.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7874   -2.5501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2164   -2.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9308   -2.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3443   -2.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7577   -2.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9308   -1.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2164   -0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2164   -0.0747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0462    0.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8715    0.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2841    1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8715    2.1370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0462    2.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6335    1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6335    2.8518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1068    1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5197    0.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1108   -0.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2860   -0.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3450    0.7071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7577    1.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  6  7  2  0
  7  8  1  0
  3  8  1  0
  8  9  2  0
  9  1  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 11  2  0
 17 10  1  0
 18 17  2  0
 18 19  1  0
 19  6  1  0
 20 18  1  0
 21 20  1  0
 21 22  1  0
 21 23  1  0
 24 21  1  0
 24 25  1  0
 17 25  1  0
 25 26  2  0
 27  1  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 27 32  2  0
 31 33  2  0
 29 34  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 28 37  1  0
 35 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290276

    ---

Associated Targets(Human)

Homo sapiens (32628 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

PPO2 Tyrosinase (3884 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.55Molecular Weight (Monoisotopic): 520.1747AlogP: 5.07#Rotatable Bonds: 3
Polar Surface Area: 108.82Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 4.78CX LogD: 4.78
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: -0.74

References

1. Elattar KM, El-Khateeb AY, Hamed SE..  (2022)  Insights into the recent progress in the medicinal chemistry of pyranopyrimidine analogs.,  13  (5.0): [PMID:35694689] [10.1039/d2md00076h]

Source