The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4S)-2-fluoro-4-(4-(((2-methyl-4-oxo-3,4-dihydroquinazolin-6-yl)methyl)(prop-2-yn-1-yl)amino)benzamido)pentanedioic acid ID: ALA5290357
Max Phase: Preclinical
Molecular Formula: C25H23FN4O6
Molecular Weight: 494.48
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(Cc1ccc2nc(C)[nH]c(=O)c2c1)c1ccc(C(=O)N[C@@H](C[C@H](F)C(=O)O)C(=O)O)cc1
Standard InChI: InChI=1S/C25H23FN4O6/c1-3-10-30(13-15-4-9-20-18(11-15)23(32)28-14(2)27-20)17-7-5-16(6-8-17)22(31)29-21(25(35)36)12-19(26)24(33)34/h1,4-9,11,19,21H,10,12-13H2,2H3,(H,29,31)(H,33,34)(H,35,36)(H,27,28,32)/t19-,21-/m0/s1
Standard InChI Key: PNRHJFIJPAVEEI-FPOVZHCZSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
2.8582 -1.2367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1436 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 -1.2367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1436 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8582 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5728 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5728 -0.8245 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.2873 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0020 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2873 1.2367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 0.4122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 -0.8245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0000 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0000 1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4291 1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 1.6490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8582 1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8582 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8582 -1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5728 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2874 -1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0020 -0.8245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2874 -2.0612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5728 -2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5728 -3.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8582 -2.0612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5728 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4291 2.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 3.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4291 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
4 2 1 1
4 5 1 0
5 6 1 0
6 7 1 1
6 8 1 0
8 9 1 0
8 10 2 0
11 4 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 2 0
16 15 1 0
17 16 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
24 23 2 0
25 24 1 0
25 26 2 0
27 25 1 0
28 27 1 0
28 29 1 0
30 28 2 0
30 23 1 0
24 31 1 0
31 20 2 0
18 32 1 0
32 33 1 0
33 34 3 0
35 17 1 0
36 35 2 0
14 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.48Molecular Weight (Monoisotopic): 494.1602AlogP: 1.87#Rotatable Bonds: 10Polar Surface Area: 152.69Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.21CX Basic pKa: 6.10CX LogP: 0.29CX LogD: -3.77Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.16
References 1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B.. (2018) An overview of quinazolines: Pharmacological significance and recent developments., 151 [PMID:29656203 ] [10.1016/j.ejmech.2018.03.076 ]