3-(((3R,5R,8S,9S,10S,13S,14S)-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-3-yl)amino)-3-oxopropanoic acid

ID: ALA5290461

Max Phase: Preclinical

Molecular Formula: C22H35NO3

Molecular Weight: 361.53

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@]12CCC[C@H]1[C@@H]1CC[C@@H]3C[C@H](NC(=O)CC(=O)O)CC[C@]3(C)[C@H]1CC2

Standard InChI:  InChI=1S/C22H35NO3/c1-21-9-3-4-17(21)16-6-5-14-12-15(23-19(24)13-20(25)26)7-11-22(14,2)18(16)8-10-21/h14-18H,3-13H2,1-2H3,(H,23,24)(H,25,26)/t14-,15-,16+,17+,18+,21+,22+/m1/s1

Standard InChI Key:  LNUCVTUWNZTMLA-DMNIQJBYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    3.6638    1.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8761    1.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1761    1.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4760    1.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4760    0.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7759   -0.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0760    0.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6239   -0.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6239   -1.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0760   -1.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7759   -1.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4760   -1.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1760   -1.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1760   -0.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8760    0.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6430   -0.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1250    0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9645   -0.5991    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1760    0.6089    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7759   -1.8163    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3241   -1.4121    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0243   -1.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7245   -1.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0243   -0.1993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7760    0.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4760   -0.6039    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9657    1.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4247   -1.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1250   -1.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4247   -0.1993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  5  4  1  0
  6  5  1  0
  6  7  1  0
  8  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  6  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14  5  1  0
 14 15  1  0
 15  2  1  0
 15 16  1  0
 16 17  1  0
  1 17  1  0
 15 18  1  6
 14 19  1  1
 11 20  1  1
  9 21  1  6
 21 22  1  0
 22 23  1  0
 22 24  2  0
  6 25  1  1
  5 26  1  6
  2 27  1  1
 23 28  1  0
 28 29  1  0
 28 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5290461

    ---

Associated Targets(Human)

GRIN1 Tclin Glutamate NMDA receptor; GRIN1/GRIN2B (726 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 361.53Molecular Weight (Monoisotopic): 361.2617AlogP: 4.38#Rotatable Bonds: 3
Polar Surface Area: 66.40Molecular Species: ACIDHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.13CX Basic pKa: CX LogP: 4.04CX LogD: 0.96
Aromatic Rings: Heavy Atoms: 26QED Weighted: 0.73Np Likeness Score: 1.69

References

1. Blanco MJ, La D, Coughlin Q, Newman CA, Griffin AM, Harrison BL, Salituro FG..  (2018)  Breakthroughs in neuroactive steroid drug discovery.,  28  (2): [PMID:29223589] [10.1016/j.bmcl.2017.11.043]

Source