(3S,5S,10S)-10-(4-fluorophenyl)-3-((R)-2-methoxy-6-(5-(trifluoromethyl)-1H-tetrazol-1-yl)phenyl)-1,6-dioxa-9-azaspiro[4.5]decane

ID: ALA5290533

Max Phase: Preclinical

Molecular Formula: C22H21F4N5O3

Molecular Weight: 479.43

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(-n2nnnc2C(F)(F)F)c1[C@H]1CO[C@@]2(C1)OCCN[C@H]2c1ccc(F)cc1

Standard InChI:  InChI=1S/C22H21F4N5O3/c1-32-17-4-2-3-16(31-20(22(24,25)26)28-29-30-31)18(17)14-11-21(34-12-14)19(27-9-10-33-21)13-5-7-15(23)8-6-13/h2-8,14,19,27H,9-12H2,1H3/t14-,19+,21-/m1/s1

Standard InChI Key:  QBYYSIUBCJMHSP-XWRIVVANSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    0.8152    1.2088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2277    0.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0502    0.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4629   -0.2210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0538   -0.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2293   -0.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8150   -0.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0099   -0.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5618   -0.8328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3151   -0.4974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2288    0.3226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4222    0.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3151   -1.3227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6005   -1.7351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6005   -2.5637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1158   -2.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8259   -2.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5404   -2.9725    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.8259   -1.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1139   -1.3228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0297   -1.7353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7444   -1.3227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7444   -0.4974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0297   -0.0847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2293   -1.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9437   -2.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0047    1.2950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1763    2.1016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5378    2.5139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1506    1.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9475    2.1756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1610    2.9725    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5309    1.5923    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7444    2.3892    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  7  6  1  0
  2  7  2  0
  8  7  1  6
  8  9  1  0
 10  9  1  0
 10 11  1  6
 12  8  1  0
 11 12  1  0
 13 10  1  0
 13 14  1  6
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 19 20  1  0
 20 14  2  0
 21 13  1  0
 22 21  1  0
 23 22  1  0
 10 24  1  0
 23 24  1  0
  6 25  1  0
 25 26  1  0
 27  1  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30  1  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290533

    ---

Associated Targets(Human)

TACR1 Tclin Neurokinin 1 receptor (6273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.43Molecular Weight (Monoisotopic): 479.1581AlogP: 3.39#Rotatable Bonds: 4
Polar Surface Area: 83.32Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.87CX LogP: 3.84CX LogD: 3.73
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.57Np Likeness Score: -0.67

References

1. Wu YJ, Meanwell NA..  (2021)  Geminal Diheteroatomic Motifs: Some Applications of Acetals, Ketals, and Their Sulfur and Nitrogen Homologues in Medicinal Chemistry and Drug Design.,  64  (14.0): [PMID:34213340] [10.1021/acs.jmedchem.1c00790]

Source