The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,5S,10S)-10-(4-fluorophenyl)-3-((R)-2-methoxy-6-(5-(trifluoromethyl)-1H-tetrazol-1-yl)phenyl)-1,6-dioxa-9-azaspiro[4.5]decane ID: ALA5290533
Max Phase: Preclinical
Molecular Formula: C22H21F4N5O3
Molecular Weight: 479.43
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(-n2nnnc2C(F)(F)F)c1[C@H]1CO[C@@]2(C1)OCCN[C@H]2c1ccc(F)cc1
Standard InChI: InChI=1S/C22H21F4N5O3/c1-32-17-4-2-3-16(31-20(22(24,25)26)28-29-30-31)18(17)14-11-21(34-12-14)19(27-9-10-33-21)13-5-7-15(23)8-6-13/h2-8,14,19,27H,9-12H2,1H3/t14-,19+,21-/m1/s1
Standard InChI Key: QBYYSIUBCJMHSP-XWRIVVANSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
0.8152 1.2088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2277 0.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0502 0.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4629 -0.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0538 -0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2293 -0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8150 -0.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0099 -0.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5618 -0.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3151 -0.4974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2288 0.3226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4222 0.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3151 -1.3227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6005 -1.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6005 -2.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1158 -2.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8259 -2.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5404 -2.9725 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.8259 -1.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1139 -1.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0297 -1.7353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7444 -1.3227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7444 -0.4974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0297 -0.0847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2293 -1.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9437 -2.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0047 1.2950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1763 2.1016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5378 2.5139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1506 1.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9475 2.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1610 2.9725 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5309 1.5923 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.7444 2.3892 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
7 6 1 0
2 7 2 0
8 7 1 6
8 9 1 0
10 9 1 0
10 11 1 6
12 8 1 0
11 12 1 0
13 10 1 0
13 14 1 6
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
17 19 2 0
19 20 1 0
20 14 2 0
21 13 1 0
22 21 1 0
23 22 1 0
10 24 1 0
23 24 1 0
6 25 1 0
25 26 1 0
27 1 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 1 1 0
30 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.43Molecular Weight (Monoisotopic): 479.1581AlogP: 3.39#Rotatable Bonds: 4Polar Surface Area: 83.32Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.87CX LogP: 3.84CX LogD: 3.73Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.57Np Likeness Score: -0.67
References 1. Wu YJ, Meanwell NA.. (2021) Geminal Diheteroatomic Motifs: Some Applications of Acetals, Ketals, and Their Sulfur and Nitrogen Homologues in Medicinal Chemistry and Drug Design., 64 (14.0): [PMID:34213340 ] [10.1021/acs.jmedchem.1c00790 ]