The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-indol-3-yl]-N-[(4-fluorophenyl)carbamothioyl]acetamide ID: ALA5290545
Max Phase: Preclinical
Molecular Formula: C26H21ClFN3O3S
Molecular Weight: 509.99
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)c(CC(=O)NC(=S)Nc1ccc(F)cc1)c(C)n2C(=O)c1ccc(Cl)cc1
Standard InChI: InChI=1S/C26H21ClFN3O3S/c1-15-21(14-24(32)30-26(35)29-19-9-7-18(28)8-10-19)22-13-20(34-2)11-12-23(22)31(15)25(33)16-3-5-17(27)6-4-16/h3-13H,14H2,1-2H3,(H2,29,30,32,35)
Standard InChI Key: JJTWXUGJJCQZTD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-2.1241 1.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 1.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0489 0.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7025 -0.1171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3700 0.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1684 0.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7237 0.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4808 1.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6816 1.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2562 0.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7025 -0.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9917 -1.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4132 -1.3481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2809 -0.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4273 -1.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4273 -2.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2791 -2.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9917 -2.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1380 -2.5790 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.8887 1.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0680 1.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3422 2.5790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3422 1.1576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1629 1.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5732 0.4469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5732 1.8683 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.3940 0.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8045 1.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6227 1.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0332 0.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6262 -0.2621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8060 -0.2668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0611 2.1613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8539 1.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8539 0.4458 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
1 5 2 0
5 4 1 0
5 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
1 9 1 0
3 10 1 0
4 11 1 0
11 12 1 0
11 13 2 0
14 12 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
12 18 1 0
16 19 1 0
2 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
8 33 1 0
33 34 1 0
30 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.99Molecular Weight (Monoisotopic): 509.0976AlogP: 5.50#Rotatable Bonds: 5Polar Surface Area: 72.36Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.24CX Basic pKa: ┄CX LogP: 5.65CX LogD: 5.65Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -1.67
References 1. Ahmadi M, Bekeschus S, Weltmann KD, von Woedtke T, Wende K.. (2022) Non-steroidal anti-inflammatory drugs: recent advances in the use of synthetic COX-2 inhibitors., 13 (5.0): [PMID:35685617 ] [10.1039/d1md00280e ]