The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-(((R)-1-(3-amino-5-(trifluoromethyl)phenyl)ethyl)amino)-6-methoxy-2-methylquinazolin-7-yl)oxy)-N-(2-(2,6-dioxopiperidin-3-yl)-1-oxoisoindolin-4-yl)acetamide ID: ALA5290590
Max Phase: Preclinical
Molecular Formula: C34H32F3N7O6
Molecular Weight: 691.67
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(N[C@H](C)c3cc(N)cc(C(F)(F)F)c3)nc(C)nc2cc1OCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O
Standard InChI: InChI=1S/C34H32F3N7O6/c1-16(18-9-19(34(35,36)37)11-20(38)10-18)39-31-22-12-27(49-3)28(13-25(22)40-17(2)41-31)50-15-30(46)42-24-6-4-5-21-23(24)14-44(33(21)48)26-7-8-29(45)43-32(26)47/h4-6,9-13,16,26H,7-8,14-15,38H2,1-3H3,(H,42,46)(H,39,40,41)(H,43,45,47)/t16-,26?/m1/s1
Standard InChI Key: GVWBZLKKNJQQQV-DIERRCTGSA-N
Molfile:
RDKit 2D
50 55 0 0 0 0 0 0 0 0999 V2000
-2.3910 2.8857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1057 2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1057 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8202 1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5348 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5348 2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8202 2.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2493 2.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2493 3.7103 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.9640 3.2980 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.9640 2.4735 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8202 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5348 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1057 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1057 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8202 -1.2367 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8202 -2.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5348 -2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1057 -2.4735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3910 -2.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3910 -1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6765 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9619 -1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9619 -2.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2473 -2.4735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4672 -2.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1818 -2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1818 -3.2980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8964 -2.0612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6110 -2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6110 -3.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3255 -3.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0401 -3.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0401 -2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3255 -2.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4904 -1.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3150 -1.1818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7272 -0.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5517 -0.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9640 0.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5517 0.9619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7272 0.9619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3150 0.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4904 0.2473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9640 1.6764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6448 -1.9239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4692 -2.1162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6765 -2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2473 -0.8245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4672 -1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
2 7 2 0
7 6 1 0
6 8 1 0
8 9 1 0
8 10 1 0
8 11 1 0
4 12 1 0
12 13 1 6
12 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
17 19 1 0
19 20 2 0
15 21 2 0
21 20 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
30 35 1 0
35 34 2 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
42 41 1 0
38 43 1 0
43 42 1 0
43 44 2 0
41 45 2 0
34 46 1 0
37 46 1 0
46 47 2 0
20 48 1 0
24 48 2 0
23 49 1 0
49 50 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 691.67Molecular Weight (Monoisotopic): 691.2366AlogP: 4.50#Rotatable Bonds: 9Polar Surface Area: 177.87Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.51CX Basic pKa: 6.78CX LogP: 3.09CX LogD: 3.05Aromatic Rings: 4Heavy Atoms: 50QED Weighted: 0.14Np Likeness Score: -0.95
References 1. Bian Y, Alem D, Beato F, Hogenson TL, Yang X, Jiang K, Cai J, Ma WW, Fernandez-Zapico M, Tan AC, Lawrence NJ, Fleming JB, Yuan Y, Xie H.. (2022) Development of SOS1 Inhibitor-Based Degraders to Target KRAS -Mutant Colorectal Cancer., 65 (24.0): [PMID:36459180 ] [10.1021/acs.jmedchem.2c01300 ]