The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Allyl (3-(benzo[d]thiazol-2-yl)-7-(diethylamino)-2H-chromen-2-ylidene)carbamate ID: ALA5290608
Max Phase: Preclinical
Molecular Formula: C24H23N3O3S
Molecular Weight: 433.53
Associated Items:
Names and Identifiers Canonical SMILES: C=CCOC(=O)/N=c1\oc2cc(N(CC)CC)ccc2cc1-c1nc2ccccc2s1
Standard InChI: InChI=1S/C24H23N3O3S/c1-4-13-29-24(28)26-22-18(23-25-19-9-7-8-10-21(19)31-23)14-16-11-12-17(15-20(16)30-22)27(5-2)6-3/h4,7-12,14-15H,1,5-6,13H2,2-3H3/b26-22-
Standard InChI Key: HBWNDXAVUPAAIJ-ROMGYVFFSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-2.1335 0.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1335 -0.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4201 -1.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7130 -0.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7130 0.0894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4219 0.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0034 0.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7103 0.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7103 -0.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0016 -1.1445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4219 -1.1405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4219 -1.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1335 -2.3730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8451 -1.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5567 -2.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2683 -1.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7103 -2.3730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4201 0.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1997 0.2538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6896 0.9186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2208 1.5694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4201 1.3204 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5496 2.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3478 2.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8157 1.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4910 0.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8451 -1.1467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8451 -1.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5567 -2.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5567 -0.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2683 -1.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
8 7 2 0
9 8 1 0
10 9 1 0
4 10 1 0
9 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
12 17 2 0
18 8 1 0
18 19 2 0
19 20 1 0
21 20 2 0
22 21 1 0
18 22 1 0
21 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
20 26 1 0
2 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.53Molecular Weight (Monoisotopic): 433.1460AlogP: 5.78#Rotatable Bonds: 6Polar Surface Area: 67.93Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.30CX LogP: 5.69CX LogD: 5.69Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.36Np Likeness Score: -1.33
References 1. Mou Y, Wen S, Li YX, Gao XX, Zhang X, Jiang ZY.. (2020) Recent progress in Keap1-Nrf2 protein-protein interaction inhibitors., 202 [PMID:32668381 ] [10.1016/j.ejmech.2020.112532 ]