Penicibilane B

ID: ALA5290633

Max Phase: Preclinical

Molecular Formula: C17H26O3

Molecular Weight: 278.39

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@@H]1C[C@H](C)[C@@]23CC=C(C)[C@@H](C2)C[C@@](C)(O)[C@@H]13

Standard InChI:  InChI=1S/C17H26O3/c1-10-5-6-17-9-13(10)8-16(4,19)15(17)14(7-11(17)2)20-12(3)18/h5,11,13-15,19H,6-9H2,1-4H3/t11-,13+,14+,15+,16+,17+/m0/s1

Standard InChI Key:  MWJFQIAPGJUWFB-IIYRAJEGSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   -1.3905   -0.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6760    0.3148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0383   -0.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0383   -0.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6760   -1.3350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3905   -0.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4907    1.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3105    1.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6425    0.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0738    1.7192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4391    0.2438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7524   -0.5099    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2517   -1.7192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8629   -0.9226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1047   -0.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4182    0.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1047    0.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8189   -0.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1047   -1.3349    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0223    0.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8189    0.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8088    1.6235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  9  8  1  0
  3  9  1  0
  7 10  1  1
  9 11  1  1
  3 12  1  1
  4 13  1  1
  4 14  1  0
  6 15  1  0
  2 16  1  0
 15 17  2  0
 16 17  1  0
 15 18  1  0
  6 19  1  6
 11 20  1  0
 20 21  1  0
 20 22  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5290633

    ---

Associated Targets(non-human)

Colletotrichum gloeosporioides (560 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 278.39Molecular Weight (Monoisotopic): 278.1882AlogP: 3.07#Rotatable Bonds: 1
Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.03CX LogD: 2.03
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.59Np Likeness Score: 3.07

References

1. El-Hossary EM, Cheng C, Hamed MM, Hamed MM, El-Sayed Hamed AN, Ohlsen K, Hentschel U, Abdelmohsen UR..  (2017)  Antifungal potential of marine natural products.,  126  [PMID:27936443] [10.1016/j.ejmech.2016.11.022]

Source