The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-(1H-indol-3-yl)-5-(octylamino)benzo[de]imidazo[4,5-g]isoquinoline-4,6(5H,8H)-dione ID: ALA5290745
Max Phase: Preclinical
Molecular Formula: C29H29N5O2
Molecular Weight: 479.58
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCNN1C(=O)c2cccc3c2c(cc2[nH]c(-c4c[nH]c5ccccc45)nc23)C1=O
Standard InChI: InChI=1S/C29H29N5O2/c1-2-3-4-5-6-9-15-31-34-28(35)20-13-10-12-19-25(20)21(29(34)36)16-24-26(19)33-27(32-24)22-17-30-23-14-8-7-11-18(22)23/h7-8,10-14,16-17,30-31H,2-6,9,15H2,1H3,(H,32,33)
Standard InChI Key: BCMUINJWOZXXGF-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
-6.6002 0.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8858 0.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1712 0.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4567 0.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7422 0.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0277 0.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3132 0.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5987 0.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8841 0.7740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1696 0.3614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5401 0.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2668 0.3713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9813 0.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6931 0.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6931 -0.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9831 -0.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2668 -0.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5525 -0.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1696 -0.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8788 -0.8790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5525 -1.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2758 -2.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9831 -1.6867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4759 -0.6991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9679 -0.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4972 0.6219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7929 -0.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2054 0.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0268 0.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1076 -0.3039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3479 -0.6360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6002 1.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3454 1.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5277 2.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9566 1.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5401 1.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
7 6 1 0
8 7 1 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
17 18 1 0
18 19 1 0
10 19 1 0
19 20 2 0
18 21 2 0
21 22 1 0
22 23 2 0
16 23 1 0
15 24 1 0
24 25 2 0
26 25 1 0
14 26 1 0
27 25 1 0
27 28 1 0
28 29 2 0
29 30 1 0
31 30 1 0
27 31 2 0
29 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
28 35 1 0
11 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.58Molecular Weight (Monoisotopic): 479.2321AlogP: 6.33#Rotatable Bonds: 9Polar Surface Area: 93.88Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.89CX Basic pKa: 4.04CX LogP: 6.12CX LogD: 6.11Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.17Np Likeness Score: -0.33
References 1. Tomczyk MD, Walczak KZ.. (2018) l,8-Naphthalimide based DNA intercalators and anticancer agents. A systematic review from 2007 to 2017., 159 [PMID:30312931 ] [10.1016/j.ejmech.2018.09.055 ]