N-(4-(7-bromoimidazo[1,2-a]pyridin-3-yl)phenyl)-5-nitrofuran-2-carboxamide

ID: ALA5290748

Max Phase: Preclinical

Molecular Formula: C18H11BrN4O4

Molecular Weight: 427.21

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(-c2cnc3cc(Br)ccn23)cc1)c1ccc([N+](=O)[O-])o1

Standard InChI:  InChI=1S/C18H11BrN4O4/c19-12-7-8-22-14(10-20-16(22)9-12)11-1-3-13(4-2-11)21-18(24)15-5-6-17(27-15)23(25)26/h1-10H,(H,21,24)

Standard InChI Key:  RQFCXAAMFXWGNX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    4.9955   -0.3882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5831   -1.1027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9955   -1.8170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7581   -1.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3458   -1.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5392   -1.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4530   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2063   -0.4899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7385   -0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7385    0.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0240   -0.8253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3096   -0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4007   -0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1174   -0.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1174    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8323    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9185    1.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7256    1.8170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1382    1.1026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9487    0.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1987    0.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9955   -0.0692    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -3.6480   -0.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8407   -0.2927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5861    0.4894    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4025    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3096    0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  8  4  1  0
  8  7  1  0
  9  7  1  0
  9 10  2  0
 11  9  1  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 19 20  1  0
 20 21  2  0
 22 21  1  0
 21 23  1  0
 23 24  2  0
 25 24  1  0
 25 19  1  0
 16 25  1  0
 26 15  2  0
 12 27  2  0
 27 26  1  0
M  CHG  2   2   1   3  -1
M  END

Alternative Forms

  1. Parent:

    ALA5290748

    ---

Associated Targets(Human)

AGS (1999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.21Molecular Weight (Monoisotopic): 425.9964AlogP: 4.52#Rotatable Bonds: 4
Polar Surface Area: 102.68Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.62CX Basic pKa: 5.76CX LogP: 3.28CX LogD: 3.27
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.38Np Likeness Score: -1.87

References

1. Li H, Ouyang S, Zhang Y, Peng K, Fang W, Liu Z, Wang CY, Zhang X, Wang Y..  (2022)  Structural optimization of Imidazo[1, 2-a]pyridine derivatives for the treatment of gastric cancer via STAT3 signaling pathway.,  244  [PMID:36283181] [10.1016/j.ejmech.2022.114858]

Source