2-phenyl-3-(4-(trifluoromethyl)styryl)quinazolin-4(3H)-one

ID: ALA5290758

Max Phase: Preclinical

Molecular Formula: C23H15F3N2O

Molecular Weight: 392.38

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1c2ccccc2nc(-c2ccccc2)n1/C=C/c1ccc(C(F)(F)F)cc1

Standard InChI:  InChI=1S/C23H15F3N2O/c24-23(25,26)18-12-10-16(11-13-18)14-15-28-21(17-6-2-1-3-7-17)27-20-9-5-4-8-19(20)22(28)29/h1-15H/b15-14+

Standard InChI Key:  DATUHYXUONUBGV-CCEZHUSRSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -0.3570   -1.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0715   -0.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0715   -0.0015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3588    0.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3556   -0.0015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0701    0.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7877   -0.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4978    0.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4978    1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7831    1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0701    1.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2124    1.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2124    2.4716    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.9269    1.2340    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.9269    2.0591    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7881    0.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7881    1.2359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5007    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5007   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7830   -1.2389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2107   -1.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9269   -0.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9269   -0.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2124    0.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3576   -0.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0696   -1.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0696   -2.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3594   -2.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570   -2.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  6  2  0
  9 12  1  0
 12 13  1  0
 12 14  1  0
 12 15  1  0
  3 16  1  0
 16 17  2  0
 18 16  1  0
 19 18  2  0
 19 20  1  0
 20  2  2  0
 21 19  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 18 24  1  0
 25  1  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
  1 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290758

    ---

Associated Targets(non-human)

Tobacco mosaic virus (2972 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.38Molecular Weight (Monoisotopic): 392.1136AlogP: 5.71#Rotatable Bonds: 3
Polar Surface Area: 34.89Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.76CX LogP: 5.84CX LogD: 5.84
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.45Np Likeness Score: -0.69

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source