The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,2'S,4'R)-6-hydroxy-4'-(4-methoxyphenyl)-1',1''-dimethyl-3H-dispiro[benzofuran-2,3'-pyrrolidine-2',3''-indoline]-2'',3-dione ID: ALA5290802
Max Phase: Preclinical
Molecular Formula: C27H24N2O5
Molecular Weight: 456.50
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@@H]2CN(C)[C@]3(C(=O)N(C)c4ccccc43)[C@]23Oc2cc(O)ccc2C3=O)cc1
Standard InChI: InChI=1S/C27H24N2O5/c1-28-15-21(16-8-11-18(33-3)12-9-16)27(24(31)19-13-10-17(30)14-23(19)34-27)26(28)20-6-4-5-7-22(20)29(2)25(26)32/h4-14,21,30H,15H2,1-3H3/t21-,26+,27-/m0/s1
Standard InChI Key: KWPUWFLGKMUBEI-KWTBFXGESA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
-2.6741 2.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1052 2.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2801 2.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0241 1.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6215 1.0668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4465 1.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3086 -0.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5120 -0.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5405 -1.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3370 -1.3797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8207 -0.6685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6500 -2.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3129 -0.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7681 -1.7211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2276 -2.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5689 -2.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2517 -2.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1379 -3.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3698 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3129 -3.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6215 -1.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1379 -0.7538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3129 0.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6258 0.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9672 -0.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2845 -0.7538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8207 -0.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3043 0.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9629 1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1095 1.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1577 0.3555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8534 1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3327 3.5134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1577 3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
7 5 1 1
7 8 1 0
8 9 1 0
9 10 1 0
11 10 1 0
7 11 1 0
10 12 1 0
9 13 1 1
13 14 1 0
14 15 1 0
16 15 2 0
9 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
15 20 1 0
14 21 1 0
13 22 2 0
8 23 1 0
23 24 1 0
24 25 2 0
26 25 1 0
8 26 1 1
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
24 30 1 0
28 31 1 0
23 32 2 0
2 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.50Molecular Weight (Monoisotopic): 456.1685AlogP: 3.32#Rotatable Bonds: 2Polar Surface Area: 79.31Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.69CX Basic pKa: 6.19CX LogP: 3.09CX LogD: 3.03Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.64Np Likeness Score: 0.66
References 1. Brandão P, Marques C, Burke AJ, Pineiro M.. (2021) The application of isatin-based multicomponent-reactions in the quest for new bioactive and druglike molecules., 211 [PMID:33421712 ] [10.1016/j.ejmech.2020.113102 ]