2-hydorxyanhydroaplysiatoxin

ID: ALA5290817

Max Phase: Preclinical

Molecular Formula: C32H45BrO10

Molecular Weight: 669.61

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@@H](CC[C@H](C)[C@H]1O[C@]23C[C@H](OC(=O)C[C@H]([C@@H](C)O)OC(=O)C(O)C(=C(C)CC2(C)C)O3)[C@@H]1C)c1cc(O)ccc1Br

Standard InChI:  InChI=1S/C32H45BrO10/c1-16(8-11-23(39-7)21-12-20(35)9-10-22(21)33)28-18(3)25-15-32(42-28)31(5,6)14-17(2)29(43-32)27(37)30(38)41-24(19(4)34)13-26(36)40-25/h9-10,12,16,18-19,23-25,27-28,34-35,37H,8,11,13-15H2,1-7H3/t16-,18-,19+,23-,24+,25-,27?,28+,32-/m0/s1

Standard InChI Key:  DPPGOCHFFSGODO-UIWMMILUSA-N

Molfile:  

 
     RDKit          2D

 45 48  0  0  0  0  0  0  0  0999 V2000
   -3.5699    1.9112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5699    1.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8554    0.6738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1411    1.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1411    1.9112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8554    2.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3149    1.9112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7288    2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4267    0.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4267   -0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1411   -0.5635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1411   -1.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8556   -1.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5699   -1.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5699   -0.5635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2843   -0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2843    0.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9985    1.0862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9985   -0.5633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2842   -1.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9983   -1.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2842   -2.6254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3565   -2.1850    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4270   -1.8008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7125   -0.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0016   -0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7157   -0.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4299   -0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1441   -0.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583   -0.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -0.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9985   -0.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9985   -1.3879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2886   -1.7995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.3916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2886   -2.6242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.6734    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.8583    0.6735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1441    1.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7157   -1.3880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3257    0.7172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7125   -1.3880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4267   -0.9757    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2840    2.3235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  5  7  1  0
  5  8  1  0
  4  9  1  6
 10  9  1  0
 10 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
  2 17  1  0
 17 18  1  0
 16 19  2  0
 14 20  1  0
 20 21  1  0
 20 22  1  6
 14 23  1  1
 12 24  2  0
 10 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 35 34  1  0
 36 35  2  0
 31 36  1  0
 35 37  1  0
 32 38  1  0
 30 39  1  6
 39 40  1  0
 27 41  1  6
 26 42  1  6
  4 42  1  0
 25 43  1  1
 10 44  1  6
  1 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290817

    ---

Associated Targets(non-human)

L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Nitzschia amabilis (14 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 669.61Molecular Weight (Monoisotopic): 668.2196AlogP: 5.07#Rotatable Bonds: 7
Polar Surface Area: 140.98Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.92CX Basic pKa: CX LogP: 5.17CX LogD: 5.16
Aromatic Rings: 1Heavy Atoms: 43QED Weighted: 0.34Np Likeness Score: 1.74

References

1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L..  (2020)  Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species.,  201  [PMID:32652435] [10.1016/j.ejmech.2020.112473]

Source