The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((S)-1-amino-1-oxo-3-phenylpropan-2-yl)-1-((7S,10S,E)-7-(hydroxymethyl)-10-isobutyl-5,8-dioxo-1-(4-sulfamoylphenyl)-2-oxa-3,6,9-triazaundec-3-en-11-oyl)pyrrolidine-2-carboxamide ID: ALA5290825
Max Phase: Preclinical
Molecular Formula: C32H43N7O9S
Molecular Weight: 701.80
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)/C=N/OCc1ccc(S(N)(=O)=O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(N)=O
Standard InChI: InChI=1S/C32H43N7O9S/c1-20(2)15-25(32(45)39-14-6-9-27(39)31(44)37-24(29(33)42)16-21-7-4-3-5-8-21)38-30(43)26(18-40)36-28(41)17-35-48-19-22-10-12-23(13-11-22)49(34,46)47/h3-5,7-8,10-13,17,20,24-27,40H,6,9,14-16,18-19H2,1-2H3,(H2,33,42)(H,36,41)(H,37,44)(H,38,43)(H2,34,46,47)/b35-17+/t24-,25-,26-,27-/m0/s1
Standard InChI Key: ATFCNLVUGGJYEX-DHRBKSIMSA-N
Molfile:
RDKit 2D
49 51 0 0 0 0 0 0 0 0999 V2000
-0.7765 0.8130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0620 1.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0620 2.0509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6527 0.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3674 1.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6527 -0.0123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0821 0.8129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3674 -0.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3674 -1.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0821 -0.0123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0821 -1.6629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0821 -2.4882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7969 -2.9008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7969 -3.7262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5116 -4.1390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5108 -4.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7958 -5.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0839 -4.9654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0790 -4.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7958 -6.1999 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5106 -6.6126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9972 -6.4139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5813 -6.9969 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4912 1.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2060 0.8130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4912 2.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2060 2.4636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7765 2.4636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2060 -0.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9207 -0.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4912 -0.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9595 2.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5116 2.7412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0991 3.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2922 3.2840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7086 3.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9222 4.6648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9114 3.6540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3278 4.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4692 4.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5415 5.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0421 5.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1712 6.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4110 6.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2084 6.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4225 5.9904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8427 5.4037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0528 4.6075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6829 3.2267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
4 6 1 6
5 7 1 0
6 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
17 20 1 0
20 21 1 0
20 22 2 0
20 23 2 0
24 1 1 1
24 25 1 0
24 26 1 0
26 27 1 0
26 28 2 0
25 29 1 0
29 30 1 0
29 31 1 0
32 27 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 27 1 0
35 36 1 1
36 37 2 0
36 38 1 0
38 39 1 0
39 40 1 0
39 41 1 1
41 42 1 0
43 42 2 0
44 43 1 0
45 44 2 0
46 45 1 0
47 46 2 0
42 47 1 0
40 48 1 0
40 49 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 701.80Molecular Weight (Monoisotopic): 701.2843AlogP: -0.95#Rotatable Bonds: 17Polar Surface Area: 252.68Molecular Species: NEUTRALHBA: 10HBD: 6#RO5 Violations: 2HBA (Lipinski): 16HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 10.18CX Basic pKa: ┄CX LogP: -0.23CX LogD: -0.23Aromatic Rings: 2Heavy Atoms: 49QED Weighted: 0.09Np Likeness Score: -0.56
References 1. Kugler M, Hadzima M, Dzijak R, Rampmaier R, Srb P, Vrzal L, Voburka Z, Majer P, Řezáčová P, Vrabel M.. (2023) Identification of specific carbonic anhydrase inhibitors via in situ click chemistry, phage-display and synthetic peptide libraries: comparison of the methods and structural study., 14 (1): [PMID:36760748 ] [10.1039/d2md00330a ]