(S)-N-((S)-1-amino-1-oxo-3-phenylpropan-2-yl)-1-((7S,10S,E)-7-(hydroxymethyl)-10-isobutyl-5,8-dioxo-1-(4-sulfamoylphenyl)-2-oxa-3,6,9-triazaundec-3-en-11-oyl)pyrrolidine-2-carboxamide

ID: ALA5290825

Max Phase: Preclinical

Molecular Formula: C32H43N7O9S

Molecular Weight: 701.80

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)/C=N/OCc1ccc(S(N)(=O)=O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(N)=O

Standard InChI:  InChI=1S/C32H43N7O9S/c1-20(2)15-25(32(45)39-14-6-9-27(39)31(44)37-24(29(33)42)16-21-7-4-3-5-8-21)38-30(43)26(18-40)36-28(41)17-35-48-19-22-10-12-23(13-11-22)49(34,46)47/h3-5,7-8,10-13,17,20,24-27,40H,6,9,14-16,18-19H2,1-2H3,(H2,33,42)(H,36,41)(H,37,44)(H,38,43)(H2,34,46,47)/b35-17+/t24-,25-,26-,27-/m0/s1

Standard InChI Key:  ATFCNLVUGGJYEX-DHRBKSIMSA-N

Molfile:  

 
     RDKit          2D

 49 51  0  0  0  0  0  0  0  0999 V2000
   -0.7765    0.8130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0620    1.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0620    2.0509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6527    0.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3674    1.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6527   -0.0123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0821    0.8129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3674   -0.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3674   -1.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0821   -0.0123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0821   -1.6629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0821   -2.4882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7969   -2.9008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7969   -3.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5116   -4.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5108   -4.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7958   -5.3746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0839   -4.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0790   -4.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7958   -6.1999    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5106   -6.6126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9972   -6.4139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5813   -6.9969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4912    1.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2060    0.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4912    2.0510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2060    2.4636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7765    2.4636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2060   -0.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9207   -0.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4912   -0.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9595    2.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5116    2.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0991    3.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2922    3.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7086    3.8676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9222    4.6648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9114    3.6540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3278    4.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4692    4.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5415    5.0347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0421    5.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1712    6.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4110    6.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2084    6.7832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4225    5.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8427    5.4037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0528    4.6075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6829    3.2267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  4  6  1  6
  5  7  1  0
  6  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 17 20  1  0
 20 21  1  0
 20 22  2  0
 20 23  2  0
 24  1  1  1
 24 25  1  0
 24 26  1  0
 26 27  1  0
 26 28  2  0
 25 29  1  0
 29 30  1  0
 29 31  1  0
 32 27  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 27  1  0
 35 36  1  1
 36 37  2  0
 36 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  1  1
 41 42  1  0
 43 42  2  0
 44 43  1  0
 45 44  2  0
 46 45  1  0
 47 46  2  0
 42 47  1  0
 40 48  1  0
 40 49  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5290825

    ---

Associated Targets(Human)

CA2 Tclin Carbonic anhydrase II (17698 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CA9 Tclin Carbonic anhydrase IX (8255 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CA1 Tclin Carbonic anhydrase I (13240 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CA12 Tclin Carbonic anhydrase XII (6231 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 701.80Molecular Weight (Monoisotopic): 701.2843AlogP: -0.95#Rotatable Bonds: 17
Polar Surface Area: 252.68Molecular Species: NEUTRALHBA: 10HBD: 6
#RO5 Violations: 2HBA (Lipinski): 16HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 10.18CX Basic pKa: CX LogP: -0.23CX LogD: -0.23
Aromatic Rings: 2Heavy Atoms: 49QED Weighted: 0.09Np Likeness Score: -0.56

References

1. Kugler M, Hadzima M, Dzijak R, Rampmaier R, Srb P, Vrzal L, Voburka Z, Majer P, Řezáčová P, Vrabel M..  (2023)  Identification of specific carbonic anhydrase inhibitors via in situ click chemistry, phage-display and synthetic peptide libraries: comparison of the methods and structural study.,  14  (1): [PMID:36760748] [10.1039/d2md00330a]

Source