6-((3,5-dimethylphenyl)amino)-[3,4'-bipyridine]-5-carbonitrile

ID: ALA5290888

Max Phase: Preclinical

Molecular Formula: C19H16N4

Molecular Weight: 300.37

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(C)cc(Nc2ncc(-c3ccncc3)cc2C#N)c1

Standard InChI:  InChI=1S/C19H16N4/c1-13-7-14(2)9-18(8-13)23-19-16(11-20)10-17(12-22-19)15-3-5-21-6-4-15/h3-10,12H,1-2H3,(H,22,23)

Standard InChI Key:  KUWUNRPLQQVMSZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   -1.4300    1.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4300    0.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -0.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149    1.4300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149    1.4300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4300    1.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4300    0.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1450   -0.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8598    0.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8598    1.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1450    1.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5750    1.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1450   -1.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149   -0.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4300   -0.6324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1450   -0.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8598    0.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5750   -0.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5750   -1.0725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8598   -1.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1450   -1.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
 12 14  1  0
 10 15  1  0
  4 16  1  0
 16 17  3  0
  2 18  1  0
 19 18  2  0
 20 19  1  0
 20 21  2  0
 22 21  1  0
 18 23  1  0
 23 22  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5290888

    ---

Associated Targets(Human)

NFE2L2 Tchem Nuclear factor erythroid 2-related factor 2 (95332 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 300.37Molecular Weight (Monoisotopic): 300.1375AlogP: 4.38#Rotatable Bonds: 3
Polar Surface Area: 61.60Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.89CX LogP: 4.10CX LogD: 4.10
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.78Np Likeness Score: -1.44

References

1. Hou Z, Lockwood L, Zhang D, Occhiuto CJ, Mo L, Aldrich KE, Stoub HE, Gallo KA, Liby KT, Odom AL..  (2023)  Exploring structural effects in a new class of NRF2 inhibitors.,  14  (1.0): [PMID:36760735] [10.1039/d2md00211f]

Source