5-((2-methylpyridin-3-yl)methyl)imidazo[1,5-a]quinoxalin-4(5H)-one

ID: ALA5290905

Max Phase: Preclinical

Molecular Formula: C17H14N4O

Molecular Weight: 290.33

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncccc1Cn1c(=O)c2cncn2c2ccccc21

Standard InChI:  InChI=1S/C17H14N4O/c1-12-13(5-4-8-19-12)10-20-14-6-2-3-7-15(14)21-11-18-9-16(21)17(20)22/h2-9,11H,10H2,1H3

Standard InChI Key:  PGYNVULSMXTLMT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 25  0  0  0  0  0  0  0  0999 V2000
   -1.0703   -0.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3559   -1.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3559   -2.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0657   -2.4971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7792   -2.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7792   -1.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3557   -2.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559   -0.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559   -0.0339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0675    0.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7792   -0.0339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0675    1.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6781    1.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3440    2.4990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5268    2.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559    1.6095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3557    1.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3557    0.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0627   -0.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7761    0.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7761    1.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0645    1.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  1  6  2  0
  6  5  1  0
  3  7  1  0
  8  2  1  0
  9  8  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 12 16  1  0
 17 16  1  0
 18  9  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 17 22  1  0
 22 21  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5290905

    ---

Associated Targets(Human)

GABRA5 Tclin GABA receptor alpha-5 subunit (699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GABRA1 Tclin GABA receptor alpha-1 subunit (399 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 290.33Molecular Weight (Monoisotopic): 290.1168AlogP: 2.40#Rotatable Bonds: 2
Polar Surface Area: 52.19Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.57CX LogP: 1.28CX LogD: 1.27
Aromatic Rings: 4Heavy Atoms: 22QED Weighted: 0.57Np Likeness Score: -1.14

References

1. Károlyi BI, Potor A, Kapus GL, Fodor L, Bobok A, Krámos B, Magdó I, Bata I, Szabó G..  (2023)  Novel imidazo[1,5-a]quinoxaline derivatives: SAR, selectivity and modeling challenges en route to the identification of an α5-GABAA receptor NAM.,  80  [PMID:36549396] [10.1016/j.bmcl.2022.129107]

Source