4-Acetoxydolastane

ID: ALA5290964

Max Phase: Preclinical

Molecular Formula: C21H32O4

Molecular Weight: 348.48

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1CC[C@@H](OC(C)=O)[C@H]2CC=C3[C@](C)(CC[C@]3(O)C(C)C)C[C@]12O

Standard InChI:  InChI=1S/C21H32O4/c1-13(2)20(23)11-10-19(5)12-21(24)14(3)6-8-17(25-15(4)22)16(21)7-9-18(19)20/h9,13,16-17,23-24H,3,6-8,10-12H2,1-2,4-5H3/t16-,17-,19-,20+,21+/m1/s1

Standard InChI Key:  XOWFFSZGRWKZLS-LPOYBJAFSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   -1.2739    1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2739    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6318   -0.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1656   -0.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5207    0.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1650    1.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6318    1.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7724    1.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4726    1.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3228    0.7396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9060    0.1563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7028    0.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6926   -0.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1107    0.9838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1650    2.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9884   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7028    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7028    1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9884    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9884    2.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9884   -1.0310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2740   -1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2740   -2.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5596   -1.0310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5596    0.6185    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3331    1.8538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  7  6  1  0
  1  7  1  0
  6  8  1  0
  8  9  1  0
 10  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  1  0
 10 14  1  1
  6 15  1  6
  2 16  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
  1 19  1  0
 19 20  2  0
 16 21  1  6
 21 22  1  0
 22 23  1  0
 22 24  2  0
  2 25  1  1
  1 26  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5290964

    ---

Associated Targets(non-human)

Leishmania amazonensis (3813 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.48Molecular Weight (Monoisotopic): 348.2301AlogP: 3.52#Rotatable Bonds: 2
Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.90CX Basic pKa: CX LogP: 2.45CX LogD: 2.45
Aromatic Rings: Heavy Atoms: 25QED Weighted: 0.59Np Likeness Score: 2.56

References

1. Cockram PE, Smith TK..  (2018)  Active Natural Product Scaffolds against Trypanosomatid Parasites: A Review.,  81  (9): [PMID:30234295] [10.1021/acs.jnatprod.8b00159]

Source