8-cyclopentyl-6-hydroxy-2-((1-(methylsulfonyl)piperidin-4-yl)amino)pteridin-7(8H)-one

ID: ALA5291022

Max Phase: Preclinical

Molecular Formula: C17H24N6O4S

Molecular Weight: 408.48

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)N1CCC(Nc2ncc3nc(O)c(=O)n(C4CCCC4)c3n2)CC1

Standard InChI:  InChI=1S/C17H24N6O4S/c1-28(26,27)22-8-6-11(7-9-22)19-17-18-10-13-14(21-17)23(12-4-2-3-5-12)16(25)15(24)20-13/h10-12H,2-9H2,1H3,(H,20,24)(H,18,19,21)

Standard InChI Key:  HFKNPWLMGOWKIR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    0.4133   -0.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1279    0.1890    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8397   -0.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8397   -1.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1296   -1.4597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4133   -1.0517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5544    0.1897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2691   -0.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2691   -1.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5544   -1.4606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9837    0.1897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9837   -1.4606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3013    0.1893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0159   -0.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5544    1.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8872    1.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1420    2.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9668    2.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2216    1.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0161   -1.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7290   -1.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4438   -1.0464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4454   -0.2253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7336    0.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1585   -1.4589    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1585   -2.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5718   -0.7430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9837   -1.4589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
  8 11  2  0
  9 12  1  0
  1 13  1  0
 13 14  1  0
 15  7  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 20 14  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 14 24  1  0
 22 25  1  0
 25 26  1  0
 25 27  2  0
 25 28  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5291022

    ---

Associated Targets(Human)

CCNE1 Tchem Cyclin-dependent kinase 2/cyclin E (1410 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.48Molecular Weight (Monoisotopic): 408.1580AlogP: 0.84#Rotatable Bonds: 4
Polar Surface Area: 130.31Molecular Species: ACIDHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.18CX Basic pKa: 2.24CX LogP: -0.53CX LogD: -3.55
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.76Np Likeness Score: -1.40

References

1. Wang X, Ding L, Jiang H, Yuan X, Xiang L, Tang C..  (2023)  Synthesis and biological evaluation of novel pteridin-7(8H)-one derivatives as potent CDK2 inhibitors.,  88  [PMID:37060933] [10.1016/j.bmcl.2023.129284]

Source