(R)-1-(3-(4-amino-3-(quinolin-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl)pyrrolidin-1-yl)prop-2-en-1-one

ID: ALA5291034

Max Phase: Preclinical

Molecular Formula: C21H19N7O

Molecular Weight: 385.43

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)N1CC[C@@H](n2nc(-c3cnc4ccccc4c3)c3c(N)ncnc32)C1

Standard InChI:  InChI=1S/C21H19N7O/c1-2-17(29)27-8-7-15(11-27)28-21-18(20(22)24-12-25-21)19(26-28)14-9-13-5-3-4-6-16(13)23-10-14/h2-6,9-10,12,15H,1,7-8,11H2,(H2,22,24,25)/t15-/m1/s1

Standard InChI Key:  SJLAAMAKAKHNLF-OAHLLOKOSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    0.0229   -3.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7805   -3.4904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0219   -4.2772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5849   -3.9026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2602   -2.5122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2352   -1.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2352   -1.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0260   -1.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0385   -2.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2498   -0.1852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5298   -0.5849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8221   -0.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8387    0.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5589    1.0634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2666    0.6389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4391    0.2767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0354   -0.4016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0603    0.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1436    3.1116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3808    2.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1810    1.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9845    1.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2259    2.6995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0251    2.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2666    3.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7046    4.2772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9012    4.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6598    3.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5754    1.8836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  1  4  2  0
  1  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  5  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 16 17  1  0
 12 17  1  0
  7 17  1  6
 16 18  2  0
 13 18  1  0
 19 20  2  0
 20 21  1  0
 18 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 19 28  1  0
 23 28  1  0
 14 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5291034

    ---

Associated Targets(Human)

FGFR2 Tclin Fibroblast growth factor receptor 2 (3405 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EGFR Tclin Epidermal growth factor receptor erbB1 (33727 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.43Molecular Weight (Monoisotopic): 385.1651AlogP: 2.58#Rotatable Bonds: 3
Polar Surface Area: 102.82Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.14CX LogP: 1.77CX LogD: 1.77
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.54Np Likeness Score: -1.00

References

1. Ito S, Otsuki S, Ohsawa H, Hirano A, Kazuno H, Yamashita S, Egami K, Shibata Y, Yamamiya I, Yamashita F, Kodama Y, Funabashi K, Kazuno H, Komori T, Suzuki S, Sootome H, Hirai H, Sagara T..  (2023)  Discovery of Futibatinib: The First Covalent FGFR Kinase Inhibitor in Clinical Use.,  14  (4): [PMID:37077386] [10.1021/acsmedchemlett.3c00006]

Source