The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ustilagomaydisin A ID: ALA5291131
Max Phase: Preclinical
Molecular Formula: C32H57N5O
Molecular Weight: 527.84
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCCC(=O)CC(CCCCCCCC)n1cnc2c(N)ncnc21
Standard InChI: InChI=1S/C32H57N5O/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-22-24-29(38)25-28(23-21-19-10-8-6-4-2)37-27-36-30-31(33)34-26-35-32(30)37/h26-28H,3-25H2,1-2H3,(H2,33,34,35)
Standard InChI Key: BNSPDLXZJHEPLH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
-7.4221 2.9635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.7077 3.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9932 2.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9932 2.1384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7077 1.7259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.4221 2.1384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7077 4.2008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1891 3.2136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7184 2.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2104 1.8926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9969 1.0959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2002 0.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6170 1.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8203 1.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8305 2.2623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5801 0.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3667 -0.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9499 -0.8671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7364 -1.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3196 -2.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1061 -3.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6894 -3.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4759 -4.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2371 1.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4404 1.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8572 2.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0605 1.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5226 2.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3193 2.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9025 2.9446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6992 2.7311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2824 3.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0791 3.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6623 3.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4590 3.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0422 4.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8389 3.8404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4221 4.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
4 3 1 0
5 4 2 0
1 6 2 0
6 5 1 0
2 7 1 0
3 8 1 0
8 9 2 0
10 9 1 0
4 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
11 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
14 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.84Molecular Weight (Monoisotopic): 527.4563AlogP: 9.53#Rotatable Bonds: 25Polar Surface Area: 86.69Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.14CX LogP: 10.27CX LogD: 10.27Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.13Np Likeness Score: 0.15
References 1. He ZX, Zhao TQ, Gong YP, Zhang X, Ma LY, Liu HM.. (2020) Pyrimidine: A promising scaffold for optimization to develop the inhibitors of ABC transporters., 200 [PMID:32497962 ] [10.1016/j.ejmech.2020.112458 ]