N-((6-(((cyclohexylmethyl)amino)methyl)imidazo[1,2-a]pyridin-2-yl)methyl)-4-oxo-4H-pyrido[1,2-a]pyrimidine-2-carboxamide

ID: ALA5291234

Max Phase: Preclinical

Molecular Formula: C25H28N6O2

Molecular Weight: 444.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCc1cn2cc(CNCC3CCCCC3)ccc2n1)c1cc(=O)n2ccccc2n1

Standard InChI:  InChI=1S/C25H28N6O2/c32-24-12-21(29-23-8-4-5-11-31(23)24)25(33)27-15-20-17-30-16-19(9-10-22(30)28-20)14-26-13-18-6-2-1-3-7-18/h4-5,8-12,16-18,26H,1-3,6-7,13-15H2,(H,27,33)

Standard InChI Key:  OBERVORNENYOLE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -5.9636    0.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9647   -0.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2518   -0.5240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2536    1.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5401    0.7163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5367   -0.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8234   -0.5178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1089   -0.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1123    0.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8302    1.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8347    1.9574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3952   -0.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3930   -1.3362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6839   -0.1001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9701   -0.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2586   -0.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4929   -0.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1757    0.7258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6284    0.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0393    0.1879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8562    0.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2684    0.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8577    1.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0346    1.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0912    0.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5018    0.1836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3246    0.1825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7349   -0.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3201   -1.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7271   -1.9521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5502   -1.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9647   -1.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5561   -0.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  4  1  2  0
  5  4  1  0
  3  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  5 10  1  0
  9 10  1  0
 10 11  2  0
  8 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 18 16  1  0
 19 18  2  0
 17 20  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 19 24  1  0
 23 24  2  0
 22 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 28 33  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5291234

    ---

Associated Targets(Human)

METTL3 Tbio N6-adenosine-methyltransferase catalytic subunit (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.54Molecular Weight (Monoisotopic): 444.2274AlogP: 2.94#Rotatable Bonds: 7
Polar Surface Area: 92.80Molecular Species: BASEHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.70CX Basic pKa: 9.45CX LogP: 1.85CX LogD: -0.19
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: -1.84

References

1. Xu P, Ge R..  (2022)  Roles and drug development of METTL3 (methyltransferase-like 3) in anti-tumor therapy.,  230  [PMID:35063732] [10.1016/j.ejmech.2022.114118]

Source