The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((8-cyclopentyl-2-(ethylamino)-7-oxo-7,8-dihydropteridin-6-yl)amino)-N,N-dimethylpiperidine-1-sulfonamide ID: ALA5291294
Max Phase: Preclinical
Molecular Formula: C20H32N8O3S
Molecular Weight: 464.60
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNc1ncc2nc(NC3CCN(S(=O)(=O)N(C)C)CC3)c(=O)n(C3CCCC3)c2n1
Standard InChI: InChI=1S/C20H32N8O3S/c1-4-21-20-22-13-16-18(25-20)28(15-7-5-6-8-15)19(29)17(24-16)23-14-9-11-27(12-10-14)32(30,31)26(2)3/h13-15H,4-12H2,1-3H3,(H,23,24)(H,21,22,25)
Standard InChI Key: WELLYZHVLMOFQP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-2.8571 1.4594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1425 1.8717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4306 1.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4306 0.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1407 0.2228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8571 0.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7159 0.2220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 0.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 1.4597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7159 1.8724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 0.2219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7159 -0.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0487 -1.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3036 -1.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1284 -1.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3832 -1.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 1.8723 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4279 1.4597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 1.8723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 1.4597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 0.6345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 0.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4279 0.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 0.2219 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 0.6345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1584 -0.4940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9843 -0.4940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5717 0.2183 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2864 0.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 1.4597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0010 0.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0010 0.2183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
3 10 1 0
8 11 2 0
12 7 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
9 17 1 0
17 18 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
23 22 1 0
18 23 1 0
21 24 1 0
24 25 1 0
24 26 2 0
24 27 2 0
6 28 1 0
28 29 1 0
25 30 1 0
25 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.60Molecular Weight (Monoisotopic): 464.2318AlogP: 1.42#Rotatable Bonds: 7Polar Surface Area: 125.35Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.64CX LogP: -0.20CX LogD: -0.20Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: -1.48
References 1. Wang X, Ding L, Jiang H, Yuan X, Xiang L, Tang C.. (2023) Synthesis and biological evaluation of novel pteridin-7(8H)-one derivatives as potent CDK2 inhibitors., 88 [PMID:37060933 ] [10.1016/j.bmcl.2023.129284 ]