The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Mimocaesalpin A; 6-(beta-boivinopyranosyl)apigenin ID: ALA5291331
Max Phase: Preclinical
Molecular Formula: C21H20O8
Molecular Weight: 400.38
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1O[C@@H](c2c(O)cc3oc(-c4ccc(O)cc4)cc(=O)c3c2O)C[C@H](O)[C@H]1O
Standard InChI: InChI=1S/C21H20O8/c1-9-20(26)14(25)8-16(28-9)18-13(24)7-17-19(21(18)27)12(23)6-15(29-17)10-2-4-11(22)5-3-10/h2-7,9,14,16,20,22,24-27H,8H2,1H3/t9-,14+,16-,20+/m1/s1
Standard InChI Key: NORMTIXLPBZOKX-WPXQMERTSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-1.4270 0.8275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7125 1.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0007 0.8279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0007 0.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7108 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4270 -0.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7139 1.2405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4285 0.8279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4285 0.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7139 -0.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1418 1.2401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7108 -1.2342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7139 -1.2350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1431 1.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 2.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8562 2.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5711 2.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5726 1.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8609 0.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2857 2.4763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1418 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1418 -1.2387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 -1.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5710 -1.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5710 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 -0.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2857 -0.0009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2857 -1.6512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 -2.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 1 0
9 8 2 0
10 9 1 0
4 10 1 0
1 11 1 0
5 12 1 0
10 13 2 0
14 8 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
14 19 1 0
19 18 2 0
17 20 1 0
21 6 1 6
21 22 1 0
23 22 1 0
24 23 1 0
25 24 1 0
21 26 1 0
26 25 1 0
25 27 1 1
24 28 1 6
23 29 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.38Molecular Weight (Monoisotopic): 400.1158AlogP: 2.15#Rotatable Bonds: 2Polar Surface Area: 140.59Molecular Species: ACIDHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.16CX Basic pKa: ┄CX LogP: 1.69CX LogD: 0.31Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.44Np Likeness Score: 2.11
References 1. Dias Silva MJ, Simonet AM, Silva NC, Dias ALT, Vilegas W, Macías FA.. (2019) Bioassay-Guided Isolation of Fungistatic Compounds from Mimosa caesalpiniifolia Leaves., 82 (6.0): [PMID:31244146 ] [10.1021/acs.jnatprod.8b01025 ]