ID: ALA5291345

Max Phase: Preclinical

Molecular Formula: C19H19N5O2

Molecular Weight: 349.39

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H]1Nc2ccc3ncc(n3n2)C(=O)NC2(CC2)COc2ccccc21

Standard InChI:  InChI=1S/C19H19N5O2/c1-12-13-4-2-3-5-15(13)26-11-19(8-9-19)22-18(25)14-10-20-17-7-6-16(21-12)23-24(14)17/h2-7,10,12H,8-9,11H2,1H3,(H,21,23)(H,22,25)/t12-/m1/s1

Standard InChI Key:  JBBAPLLCPKVUSU-GFCCVEGCSA-N

Molfile:  

 
     RDKit          2D

 26 30  0  0  0  0  0  0  0  0999 V2000
   -2.0752    2.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0752    1.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3560    1.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2304    0.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6401   -0.2485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2248   -0.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3998   -0.9614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0155   -1.6710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3324   -2.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3136   -2.9327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0571   -2.4638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8096   -1.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2501   -0.9517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8348   -0.2388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2445    0.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8292    1.1899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0042    1.1899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6431    1.6981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6431    2.5231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3624    2.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0752   -0.9517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2191   -2.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6344   -1.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4332    0.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9605    0.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9605    0.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  9  8  1  0
  9 10  2  0
 11 10  1  0
 12 11  2  0
  8 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  3 18  2  0
 18 19  1  0
 19 20  2  0
 20  1  1  0
 13 21  2  0
 22  9  1  0
 23 22  2  0
  6 23  1  0
  4 24  1  1
 15 25  1  0
 25 26  1  0
 15 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5291345

    ---

Associated Targets(Human)

ALK Tclin ALK tyrosine kinase receptor (7132 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 349.39Molecular Weight (Monoisotopic): 349.1539AlogP: 2.56#Rotatable Bonds:
Polar Surface Area: 80.55Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.55CX LogP: 1.92CX LogD: 1.92
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.65Np Likeness Score: -0.23

References

1. Xiao X, Xu Y, Yu X, Chen Y, Zhao W, Xie Z, Zhu X, Xu H, Yang Y, Zhang P..  (2023)  Discovery of imidazo[1,2-b]pyridazine macrocyclic derivatives as novel ALK inhibitors capable of combating multiple resistant mutants.,  89  [PMID:37127101] [10.1016/j.bmcl.2023.129309]

Source