The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-N-(2-(N-(1-isopropylpiperidin-4-yl)sulfamoyl)ethyl)thiophene-2-carboxamide ID: ALA5291366
Max Phase: Preclinical
Molecular Formula: C15H24ClN3O3S2
Molecular Weight: 393.96
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)N1CCC(NS(=O)(=O)CCNC(=O)c2ccc(Cl)s2)CC1
Standard InChI: InChI=1S/C15H24ClN3O3S2/c1-11(2)19-8-5-12(6-9-19)18-24(21,22)10-7-17-15(20)13-3-4-14(16)23-13/h3-4,11-12,18H,5-10H2,1-2H3,(H,17,20)
Standard InChI Key: XIOBNAKYNXSFFO-UHFFFAOYSA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
-4.0493 0.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5484 0.7890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0779 1.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2880 1.2286 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.2704 0.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2667 2.2699 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.5689 -0.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8419 0.3595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5944 -0.8554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1404 -0.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4134 0.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2879 -0.1191 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.0149 0.2711 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7164 -0.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4434 0.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1448 -0.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1193 -1.0322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3923 -1.4225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6908 -0.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8339 -1.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5484 -1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8339 -2.2699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1253 -0.8349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7005 -0.8349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
3 6 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
15 14 1 0
16 15 1 0
17 16 1 0
18 17 1 0
19 18 1 0
14 19 1 0
17 20 1 0
20 21 1 0
20 22 1 0
12 23 2 0
12 24 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.96Molecular Weight (Monoisotopic): 393.0948AlogP: 1.92#Rotatable Bonds: 7Polar Surface Area: 78.51Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.00CX Basic pKa: 8.22CX LogP: 1.20CX LogD: 0.32Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.74Np Likeness Score: -2.28
References 1. Patel NR, Patel DV, Murumkar PR, Yadav MR.. (2016) Contemporary developments in the discovery of selective factor Xa inhibitors: A review., 121 [PMID:27322757 ] [10.1016/j.ejmech.2016.05.039 ]