5-chloro-N-(2-(N-(1-isopropylpiperidin-4-yl)sulfamoyl)ethyl)thiophene-2-carboxamide

ID: ALA5291366

Max Phase: Preclinical

Molecular Formula: C15H24ClN3O3S2

Molecular Weight: 393.96

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)N1CCC(NS(=O)(=O)CCNC(=O)c2ccc(Cl)s2)CC1

Standard InChI:  InChI=1S/C15H24ClN3O3S2/c1-11(2)19-8-5-12(6-9-19)18-24(21,22)10-7-17-15(20)13-3-4-14(16)23-13/h3-4,11-12,18H,5-10H2,1-2H3,(H,17,20)

Standard InChI Key:  XIOBNAKYNXSFFO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   -4.0493    0.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5484    0.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0779    1.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2880    1.2286    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2704    0.4038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2667    2.2699    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.5689   -0.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8419    0.3595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5944   -0.8554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1404   -0.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4134    0.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2879   -0.1191    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.0149    0.2711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7164   -0.1633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4434    0.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1448   -0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1193   -1.0322    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3923   -1.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6908   -0.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8339   -1.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5484   -1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8339   -2.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1253   -0.8349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7005   -0.8349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  3  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 14 19  1  0
 17 20  1  0
 20 21  1  0
 20 22  1  0
 12 23  2  0
 12 24  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5291366

    ---

Associated Targets(Human)

F10 Tclin Coagulation factor X (9693 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 393.96Molecular Weight (Monoisotopic): 393.0948AlogP: 1.92#Rotatable Bonds: 7
Polar Surface Area: 78.51Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.00CX Basic pKa: 8.22CX LogP: 1.20CX LogD: 0.32
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.74Np Likeness Score: -2.28

References

1. Patel NR, Patel DV, Murumkar PR, Yadav MR..  (2016)  Contemporary developments in the discovery of selective factor Xa inhibitors: A review.,  121  [PMID:27322757] [10.1016/j.ejmech.2016.05.039]

Source