The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5291368
Max Phase: Preclinical
Molecular Formula: C19H18N4O3
Molecular Weight: 350.38
Associated Items:
Names and Identifiers Canonical SMILES: COCc1c(C(=O)OC(C)C)ncc2[nH]c3ccc4nccnc4c3c12
Standard InChI: InChI=1S/C19H18N4O3/c1-10(2)26-19(24)17-11(9-25-3)15-14(8-22-17)23-12-4-5-13-18(16(12)15)21-7-6-20-13/h4-8,10,23H,9H2,1-3H3
Standard InChI Key: RYIVVNHBYBYXHF-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
0.9926 -1.3140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1718 -1.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3102 -0.7274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0283 0.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8491 0.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3313 -0.5619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1338 -0.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1338 -1.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3320 -2.0805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8610 -2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5946 -1.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5946 -0.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8628 -0.5619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3840 0.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2088 0.7390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6212 1.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2615 0.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8491 1.5361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0864 0.8218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4988 1.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3236 1.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0864 2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3236 -0.5623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3236 0.2827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5964 0.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8628 0.2865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
3 4 1 0
4 5 2 0
6 5 1 0
1 6 2 0
7 3 1 0
8 7 2 0
8 9 1 0
9 2 1 0
10 8 1 0
11 10 2 0
12 11 1 0
13 12 2 0
7 13 1 0
4 14 1 0
14 15 1 0
15 16 1 0
5 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
12 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
13 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 350.38Molecular Weight (Monoisotopic): 350.1379AlogP: 3.37#Rotatable Bonds: 4Polar Surface Area: 89.99Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.34CX Basic pKa: 1.75CX LogP: 2.04CX LogD: 2.04Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.57Np Likeness Score: -0.41
References 1. Beato A, Gori A, Boucherle B, Peuchmaur M, Haudecoeur R.. (2021) β-Carboline as a Privileged Scaffold for Multitarget Strategies in Alzheimer's Disease Therapy., 64 (3.0): [PMID:33528252 ] [10.1021/acs.jmedchem.0c01887 ]