ID: ALA5291368

Max Phase: Preclinical

Molecular Formula: C19H18N4O3

Molecular Weight: 350.38

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCc1c(C(=O)OC(C)C)ncc2[nH]c3ccc4nccnc4c3c12

Standard InChI:  InChI=1S/C19H18N4O3/c1-10(2)26-19(24)17-11(9-25-3)15-14(8-22-17)23-12-4-5-13-18(16(12)15)21-7-6-20-13/h4-8,10,23H,9H2,1-3H3

Standard InChI Key:  RYIVVNHBYBYXHF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    0.9926   -1.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1718   -1.3969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3102   -0.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0283    0.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8491    0.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3313   -0.5619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1338   -0.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1338   -1.8287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3320   -2.0805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8610   -2.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5946   -1.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5946   -0.9841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8628   -0.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3840    0.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2088    0.7390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6212    1.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2615    0.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8491    1.5361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0864    0.8218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4988    1.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3236    1.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0864    2.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3236   -0.5623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3236    0.2827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5964    0.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8628    0.2865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  3  4  1  0
  4  5  2  0
  6  5  1  0
  1  6  2  0
  7  3  1  0
  8  7  2  0
  8  9  1  0
  9  2  1  0
 10  8  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  7 13  1  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
  5 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 12 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 13 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5291368

    ---

Associated Targets(Human)

GABRA1 Tclin GABA-A receptor; anion channel (986 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 350.38Molecular Weight (Monoisotopic): 350.1379AlogP: 3.37#Rotatable Bonds: 4
Polar Surface Area: 89.99Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.34CX Basic pKa: 1.75CX LogP: 2.04CX LogD: 2.04
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.57Np Likeness Score: -0.41

References

1. Beato A, Gori A, Boucherle B, Peuchmaur M, Haudecoeur R..  (2021)  β-Carboline as a Privileged Scaffold for Multitarget Strategies in Alzheimer's Disease Therapy.,  64  (3.0): [PMID:33528252] [10.1021/acs.jmedchem.0c01887]

Source