(2R,5'S,7'R,7a'S)-1''-bromo-6-hydroxy-7'-phenyl-7',7a'-dihydro-1'H,3H,3'H-dispiro[benzofuran-2,6'-pyrrolo[1,2-c]thiazole-5',3''-indoline]-2'',3-dione

ID: ALA5291381

Max Phase: Preclinical

Molecular Formula: C26H19BrN2O4S

Molecular Weight: 535.42

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1c2ccc(O)cc2O[C@@]12[C@H](c1ccccc1)[C@H]1CSCN1[C@]21C(=O)N(Br)c2ccccc21

Standard InChI:  InChI=1S/C26H19BrN2O4S/c27-29-19-9-5-4-8-18(19)25(24(29)32)26(23(31)17-11-10-16(30)12-21(17)33-26)22(15-6-2-1-3-7-15)20-13-34-14-28(20)25/h1-12,20,22,30H,13-14H2/t20-,22-,25-,26+/m1/s1

Standard InChI Key:  OCBZHFZYDHBXGG-XPLBRSQRSA-N

Molfile:  

 
     RDKit          2D

 35 41  0  0  0  0  0  0  0  0999 V2000
   -2.9159    2.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3470    3.2004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5220    3.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2660    2.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8634    1.5788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6884    1.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5504    0.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7538    0.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7823   -0.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5789   -0.8676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0625   -0.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0711   -0.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5262   -1.2090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0142   -1.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8107   -1.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4935   -2.0339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3797   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6116   -3.2004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0711   -2.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3797   -1.2659    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    0.8960   -0.2418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5547    1.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3840    1.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7254    0.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0426   -0.2418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5788    0.2702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0623    0.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7211    1.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8676    1.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9159    0.8677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0952    1.7496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1254   -1.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9142   -1.2669    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8814   -0.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2822    0.6635    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  7  5  1  1
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11 10  1  0
  7 11  1  0
  9 12  1  1
 12 13  1  0
 13 14  1  0
 15 14  2  0
  9 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 14 19  1  0
 13 20  1  0
 12 21  2  0
  8 22  1  0
 22 23  1  0
 23 24  2  0
 25 24  1  0
  8 25  1  1
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 23 29  1  0
 27 30  1  0
 22 31  2  0
 10 32  1  0
 32 33  1  0
 34 33  1  0
 11 34  1  0
 11 35  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5291381

    ---

Associated Targets(non-human)

Tobacco mosaic virus (2972 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.42Molecular Weight (Monoisotopic): 534.0249AlogP: 4.43#Rotatable Bonds: 1
Polar Surface Area: 70.08Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.67CX Basic pKa: 3.25CX LogP: 4.41CX LogD: 4.22
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: 0.60

References

1. Brandão P, Marques C, Burke AJ, Pineiro M..  (2021)  The application of isatin-based multicomponent-reactions in the quest for new bioactive and druglike molecules.,  211  [PMID:33421712] [10.1016/j.ejmech.2020.113102]

Source