((piperazine-1-carbonothioyl)thio)methyl 4-methylpiperazine-1-carbodithioate

ID: ALA5291428

Max Phase: Preclinical

Molecular Formula: C12H22N4S4

Molecular Weight: 350.60

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(C(=S)SCSC(=S)N2CCNCC2)CC1

Standard InChI:  InChI=1S/C12H22N4S4/c1-14-6-8-16(9-7-14)12(18)20-10-19-11(17)15-4-2-13-3-5-15/h13H,2-10H2,1H3

Standard InChI Key:  PNBFXAVRUODYQC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
   -1.7861    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0717    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0717    1.2376    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3571    0.0000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0716   -0.0000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861    1.2375    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5007   -0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7861   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5007   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2151   -0.8249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2151    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5007    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2151    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9297   -0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9297   -0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2151   -1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5007   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9297   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  4  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
 10  1  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
  1 14  1  0
 15  9  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
  9 19  1  0
 12 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5291428

    ---

Associated Targets(Human)

PHGDH Tchem D-3-phosphoglycerate dehydrogenase (883 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 350.60Molecular Weight (Monoisotopic): 350.0727AlogP: 1.13#Rotatable Bonds: 2
Polar Surface Area: 21.75Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.86CX LogP: 2.04CX LogD: 1.40
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.58Np Likeness Score: -0.91

References

1. Zhao JY, Feng KR, Wang F, Zhang JW, Cheng JF, Lin GQ, Gao D, Tian P..  (2021)  A retrospective overview of PHGDH and its inhibitors for regulating cancer metabolism.,  217  [PMID:33756126] [10.1016/j.ejmech.2021.113379]

Source