The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(2-chlorophenylsulfonyl)-2-(4-(trifluoromethoxy)phenyl)-2,8-diazaspiro[4.5]decan-1-one ID: ALA5291436
Max Phase: Preclinical
Molecular Formula: C21H20ClF3N2O4S
Molecular Weight: 488.92
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1N(c2ccc(OC(F)(F)F)cc2)CCC12CCN(S(=O)(=O)c1ccccc1Cl)CC2
Standard InChI: InChI=1S/C21H20ClF3N2O4S/c22-17-3-1-2-4-18(17)32(29,30)26-12-9-20(10-13-26)11-14-27(19(20)28)15-5-7-16(8-6-15)31-21(23,24)25/h1-8H,9-14H2
Standard InChI Key: BNJPPDSHPNSOGD-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
7.1533 -7.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6673 -5.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8801 -6.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7040 -6.3148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0003 -5.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3596 -5.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1080 -4.9311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5253 -4.2175 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.6986 -4.2129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6698 -4.6387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9582 -4.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2403 -4.6355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2385 -5.4627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9546 -5.8802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5291 -3.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2499 -2.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2531 -2.1582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5384 -1.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8190 -2.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8193 -2.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1031 -3.3929 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.3595 -6.9126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7745 -7.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2232 -8.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0494 -8.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4247 -7.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9738 -6.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4996 -9.0840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1248 -9.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5752 -10.5132 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.2997 -9.8640 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.7068 -10.5315 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 2 1 0
8 7 2 0
9 8 2 0
2 10 1 0
2 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 8 1 0
8 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
20 21 1 0
4 1 1 0
3 22 2 0
1 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 1 1 0
25 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.92Molecular Weight (Monoisotopic): 488.0784AlogP: 4.45#Rotatable Bonds: 4Polar Surface Area: 66.92Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.52CX LogD: 4.52Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: -1.48
References 1. Kuhn B, Guba W, Hert J, Banner D, Bissantz C, Ceccarelli S, Haap W, Körner M, Kuglstatter A, Lerner C, Mattei P, Neidhart W, Pinard E, Rudolph MG, Schulz-Gasch T, Woltering T, Stahl M.. (2016) A Real-World Perspective on Molecular Design., 59 (9): [PMID:26878596 ] [10.1021/acs.jmedchem.5b01875 ]