The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5S,6S,9S)-5-(4-fluorophenyl)-9-(2-(trifluoromethyl)phenyl)-1,7-dioxa-4-azaspiro[5.5]undecane ID: ALA5291459
Max Phase: Preclinical
Molecular Formula: C21H21F4NO2
Molecular Weight: 395.40
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc([C@@H]2NCCO[C@@]23CC[C@@H](c2ccccc2C(F)(F)F)CO3)cc1
Standard InChI: InChI=1S/C21H21F4NO2/c22-16-7-5-14(6-8-16)19-20(27-12-11-26-19)10-9-15(13-28-20)17-3-1-2-4-18(17)21(23,24)25/h1-8,15,19,26H,9-13H2/t15-,19+,20-/m1/s1
Standard InChI Key: SJKYOVFCBLAVEU-UIAACRFSSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
-2.5001 -0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5001 -1.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7856 -1.6497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0712 -1.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0712 -0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7856 0.0002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0712 0.4123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3570 0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3570 -0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0716 0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7887 0.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5001 0.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5001 1.6474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7841 2.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0716 1.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3574 2.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3567 1.6495 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.3574 2.8866 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.3567 2.4743 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.3570 -1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3570 -2.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3592 -2.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0690 -2.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0690 -1.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3573 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7833 -2.8866 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
5 7 1 6
8 7 1 0
9 8 1 0
10 9 1 0
11 10 1 0
5 11 1 0
9 12 1 6
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 2 0
17 18 1 0
18 19 1 0
18 20 1 0
18 21 1 0
4 22 1 6
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 22 2 0
25 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 395.40Molecular Weight (Monoisotopic): 395.1508AlogP: 4.80#Rotatable Bonds: 2Polar Surface Area: 30.49Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.87CX LogP: 5.03CX LogD: 4.91Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.74Np Likeness Score: 0.06
References 1. Wu YJ, Meanwell NA.. (2021) Geminal Diheteroatomic Motifs: Some Applications of Acetals, Ketals, and Their Sulfur and Nitrogen Homologues in Medicinal Chemistry and Drug Design., 64 (14.0): [PMID:34213340 ] [10.1021/acs.jmedchem.1c00790 ]