(5S,6S,9S)-5-(4-fluorophenyl)-9-(2-(trifluoromethyl)phenyl)-1,7-dioxa-4-azaspiro[5.5]undecane

ID: ALA5291459

Max Phase: Preclinical

Molecular Formula: C21H21F4NO2

Molecular Weight: 395.40

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Fc1ccc([C@@H]2NCCO[C@@]23CC[C@@H](c2ccccc2C(F)(F)F)CO3)cc1

Standard InChI:  InChI=1S/C21H21F4NO2/c22-16-7-5-14(6-8-16)19-20(27-12-11-26-19)10-9-15(13-28-20)17-3-1-2-4-18(17)21(23,24)25/h1-8,15,19,26H,9-13H2/t15-,19+,20-/m1/s1

Standard InChI Key:  SJKYOVFCBLAVEU-UIAACRFSSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -2.5001   -0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5001   -1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7856   -1.6497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0712   -1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0712   -0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7856    0.0002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0712    0.4123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3572    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3572   -0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570   -0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0716    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7887    0.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001    0.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001    1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7841    2.0600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0716    1.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574    2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3567    1.6495    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574    2.8866    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3567    2.4743    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570   -1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570   -2.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3592   -2.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0690   -2.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0690   -1.6493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7833   -2.8866    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  5  7  1  6
  8  7  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
  5 11  1  0
  9 12  1  6
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
  4 22  1  6
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 22  2  0
 25 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5291459

    ---

Associated Targets(Human)

TACR1 Tclin Neurokinin 1 receptor (6273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.40Molecular Weight (Monoisotopic): 395.1508AlogP: 4.80#Rotatable Bonds: 2
Polar Surface Area: 30.49Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.87CX LogP: 5.03CX LogD: 4.91
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.74Np Likeness Score: 0.06

References

1. Wu YJ, Meanwell NA..  (2021)  Geminal Diheteroatomic Motifs: Some Applications of Acetals, Ketals, and Their Sulfur and Nitrogen Homologues in Medicinal Chemistry and Drug Design.,  64  (14.0): [PMID:34213340] [10.1021/acs.jmedchem.1c00790]

Source