The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[(4-Nitro-benzyl)-(3-(N-benzene sulfonyl)-ureido-benzenesulfonyl)-amino]-acetic acid ID: ALA53009
PubChem CID: 10721337
Max Phase: Preclinical
Molecular Formula: C22H20N4O9S2
Molecular Weight: 548.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CN(Cc1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1cccc(NC(=O)NS(=O)(=O)c2ccccc2)c1
Standard InChI: InChI=1S/C22H20N4O9S2/c27-21(28)15-25(14-16-9-11-18(12-10-16)26(30)31)37(34,35)20-8-4-5-17(13-20)23-22(29)24-36(32,33)19-6-2-1-3-7-19/h1-13H,14-15H2,(H,27,28)(H2,23,24,29)
Standard InChI Key: RTBPRRSADWSXAD-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
4.1792 -7.2292 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.8500 -7.2167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.6542 -6.9292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2792 -7.0250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7500 -5.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8167 -7.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7042 -7.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1417 -7.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8792 -7.7542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4917 -6.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 -6.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2167 -7.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2292 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0542 -6.6417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6500 -7.7917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2542 -7.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4167 -7.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2792 -5.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6542 -6.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7500 -4.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7292 -7.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -7.9917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0917 -7.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7042 -5.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2292 -6.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1792 -6.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 -6.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1792 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7042 -6.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7000 -8.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2167 -8.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7292 -8.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5292 -8.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8667 -7.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4375 -7.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0917 -8.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5500 -7.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 1 1 0
4 6 1 0
5 13 1 0
6 16 1 0
7 1 1 0
8 3 1 0
9 1 2 0
10 1 2 0
11 8 1 0
12 7 1 0
13 25 2 0
14 2 2 0
15 2 2 0
16 21 1 0
17 2 1 0
18 5 1 0
19 3 1 0
20 5 2 0
21 12 2 0
22 6 2 0
23 11 2 0
24 28 2 0
25 29 1 0
26 19 1 0
27 11 1 0
28 26 1 0
29 26 2 0
30 7 2 0
31 30 1 0
32 31 2 0
33 17 2 0
34 17 1 0
35 34 2 0
36 33 1 0
37 35 1 0
21 32 1 0
24 13 1 0
36 37 2 0
M CHG 2 5 1 18 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.56Molecular Weight (Monoisotopic): 548.0672AlogP: 2.38#Rotatable Bonds: 10Polar Surface Area: 193.09Molecular Species: ACIDHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.67CX Basic pKa: ┄CX LogP: 2.67CX LogD: -1.77Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: -1.69
References 1. Scozzafava A, Supuran CT.. (2000) Protease inhibitors: synthesis of potent bacterial collagenase and matrix metalloproteinase inhibitors incorporating N-4-nitrobenzylsulfonylglycine hydroxamate moieties., 43 (9): [PMID:10794702 ] [10.1021/jm990594k ]