The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
kipukasin A ID: ALA5316181
Max Phase: Preclinical
Molecular Formula: C21H24N2O10
Molecular Weight: 464.43
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C)c(C(=O)O[C@H]2[C@@H](OC(C)=O)[C@H](n3ccc(=O)[nH]c3=O)O[C@@H]2CO)c(OC)c1
Standard InChI: InChI=1S/C21H24N2O10/c1-10-7-12(29-3)8-13(30-4)16(10)20(27)33-17-14(9-24)32-19(18(17)31-11(2)25)23-6-5-15(26)22-21(23)28/h5-8,14,17-19,24H,9H2,1-4H3,(H,22,26,28)/t14-,17-,18-,19-/m1/s1
Standard InChI Key: MAWCJLLSYLMLHT-UTRMSSBJSA-N
Molfile:
RDKit 2D
33 35 0 0 1 0 0 0 0 0999 V2000
-2.3465 -1.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6864 -1.0155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9530 -0.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7779 -0.2470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0211 -1.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8018 -1.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3342 -2.3352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8980 -1.2587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4781 0.4399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.4231 -0.7592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6564 0.3659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1815 1.0405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5283 1.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3499 1.8630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8249 1.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0424 -2.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0301 -3.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7630 -2.3565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7384 -4.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7261 -4.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0055 -5.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2973 -4.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3096 -3.9850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4589 -3.6045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9932 -6.0579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6013 -3.5619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3193 -2.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0738 -2.3062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0534 2.4637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3097 -0.3827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1671 -4.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7014 -6.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 7 1 6
7 16 1 0
3 4 1 0
16 17 1 0
2 8 1 6
16 18 2 0
4 5 1 0
17 19 2 0
19 20 1 0
5 1 1 0
20 21 2 0
6 10 1 0
21 22 1 0
9 11 1 0
22 23 2 0
23 17 1 0
1 2 1 0
19 24 1 0
21 25 1 0
23 26 1 0
5 6 1 1
8 27 1 0
2 3 1 0
27 28 1 0
9 15 1 0
27 29 2 0
11 12 1 0
13 30 2 0
12 13 1 0
11 31 2 0
13 14 1 0
24 32 1 0
14 15 2 0
25 33 1 0
3 9 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.43Molecular Weight (Monoisotopic): 464.1431AlogP: -0.09#Rotatable Bonds: 7Polar Surface Area: 155.38Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.70CX Basic pKa: ┄CX LogP: 0.72CX LogD: 0.72Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: 1.15
References 1. Jiao P, Mudur SV, Gloer JB, Wicklow DT.. (2007) Kipukasins, nucleoside derivatives from Aspergillus versicolor., 70 (8): [PMID:17608440 ] [10.1021/np070241l ]