The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[5-(2,3-Bis-hydroxymethyl-6,7-dimethoxy-naphthalen-1-yl)-pyridin-2-yl]-4-pyridin-3-yl-2H-phthalazin-1-one hydrochloride ID: ALA536785
PubChem CID: 45263841
Max Phase: Preclinical
Molecular Formula: C32H27ClN4O5
Molecular Weight: 546.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2cc(CO)c(CO)c(-c3ccc(-n4nc(-c5cccnc5)c5ccccc5c4=O)nc3)c2cc1OC.Cl
Standard InChI: InChI=1S/C32H26N4O5.ClH/c1-40-27-13-21-12-22(17-37)26(18-38)30(25(21)14-28(27)41-2)19-9-10-29(34-16-19)36-32(39)24-8-4-3-7-23(24)31(35-36)20-6-5-11-33-15-20;/h3-16,37-38H,17-18H2,1-2H3;1H
Standard InChI Key: UTNKRAUHJLZGHC-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
8.8917 -5.7792 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -4.8750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -5.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -5.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7750 -6.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -1.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2042 -6.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -1.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5000 -6.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -0.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -4.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1667 -1.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -1.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1667 -3.6292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1625 -0.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4417 0.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -1.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 0.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0667 -6.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -0.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -2.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8875 -4.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1667 -2.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -3.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 -6.5792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -2.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -1.5875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 0.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3500 -6.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8792 -1.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9292 -6.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -7.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8750 0.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5917 -1.1625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5917 -0.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0917 -7.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6625 -7.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -1.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -0.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 -7.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2417 -7.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9542 -7.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 2 1 0
5 3 2 0
6 8 1 0
7 4 1 0
8 21 1 0
9 7 2 0
10 6 1 0
11 2 1 0
12 8 2 0
13 6 2 0
14 11 1 0
15 12 1 0
16 15 2 0
17 13 1 0
18 10 2 0
19 5 1 0
20 17 2 0
21 26 2 0
22 4 2 0
23 14 2 0
24 11 2 0
25 29 1 0
26 24 1 0
27 17 1 0
28 20 1 0
29 19 2 0
30 12 1 0
31 7 1 0
32 9 1 0
33 15 1 0
34 30 1 0
35 33 1 0
36 19 1 0
37 40 1 0
38 27 1 0
39 28 1 0
40 36 2 0
41 42 1 0
42 31 2 0
21 23 1 0
9 5 1 0
41 32 2 0
37 25 2 0
10 16 1 0
20 18 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.58Molecular Weight (Monoisotopic): 546.1903AlogP: 4.66#Rotatable Bonds: 7Polar Surface Area: 119.59Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.19CX LogP: 3.56CX LogD: 3.56Aromatic Rings: 6Heavy Atoms: 41QED Weighted: 0.30Np Likeness Score: -0.56
References 1. Ukita T, Sugahara M, Terakawa Y, Kuroda T, Wada K, Nakata A, Ohmachi Y, Kikkawa H, Ikezawa K, Naito K.. (1999) Novel, potent, and selective phosphodiesterase-4 inhibitors as antiasthmatic agents: synthesis and biological activities of a series of 1-pyridylnaphthalene derivatives., 42 (6): [PMID:10090791 ] [10.1021/jm980314l ]