The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Cyclohexyl-4-[8-fluoro-5-(4-fluoro-phenyl)-1,3,4,4a,5,9b-hexahydro-pyrido[4,3-b]indol-2-yl]-N-phenyl-butyramide; hydriodide ID: ALA537239
PubChem CID: 45263811
Max Phase: Preclinical
Molecular Formula: C33H38F2IN3O
Molecular Weight: 529.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: I.O=C(CCCN1CC[C@H]2[C@H](C1)c1cc(F)ccc1N2c1ccc(F)cc1)N(c1ccccc1)C1CCCCC1
Standard InChI: InChI=1S/C33H37F2N3O.HI/c34-24-13-16-28(17-14-24)38-31-18-15-25(35)22-29(31)30-23-36(21-19-32(30)38)20-7-12-33(39)37(26-8-3-1-4-9-26)27-10-5-2-6-11-27;/h1,3-4,8-9,13-18,22,27,30,32H,2,5-7,10-12,19-21,23H2;1H/t30-,32+;/m1./s1
Standard InChI Key: YIUXRWWGSGELPL-YJMJPULGSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
7.5335 -0.6288 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.3190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.2029 1.5620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.9014 0.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7006 0.8244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8991 -0.3854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.5014 0.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7006 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.2058 3.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2959 -3.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3021 -3.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0120 -5.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3080 -5.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2900 -5.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7737 1.4291 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0167 -7.0197 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.0029 1.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6029 1.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3014 0.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.8033 1.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4959 -0.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.5053 3.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9072 3.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7922 -1.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0995 0.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9081 5.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.5062 5.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0940 -0.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.2076 6.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9730 1.7915 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.2338 -1.6045 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 4 1 0
2 5 1 0
3 6 1 0
5 6 2 0
4 7 1 0
8 9 1 0
3 10 1 0
2 11 1 0
10 12 1 0
5 13 1 0
6 14 1 0
9 15 2 0
8 16 1 0
7 17 1 0
12 17 1 0
8 18 1 0
11 19 2 0
11 20 1 0
14 21 2 0
13 22 2 0
21 22 1 0
20 24 2 0
23 24 1 0
19 25 1 0
23 25 2 0
21 26 1 0
23 27 1 0
12 28 1 0
9 29 1 0
28 30 1 0
29 30 1 0
16 31 1 0
16 32 2 0
18 33 1 0
18 34 1 0
32 35 1 0
31 36 2 0
34 37 1 0
33 38 1 0
35 39 2 0
36 39 1 0
37 40 1 0
38 40 1 0
3 41 1 1
4 42 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.68Molecular Weight (Monoisotopic): 529.2905AlogP: 7.42#Rotatable Bonds: 7Polar Surface Area: 26.79Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.28CX LogP: 6.69CX LogD: 5.76Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.32Np Likeness Score: -1.29
References 1. Sarges R, Howard HR, Donahue KM, Welch WM, Dominy BW, Weissman A, Koe BK, Bordner J.. (1986) Neuroleptic activity of chiral trans-hexahydro-gamma-carbolines., 29 (1): [PMID:3941416 ] [10.1021/jm00151a002 ]