The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-(6-Ethoxy-2,3-bis-hydroxymethyl-7-methoxy-naphthalen-1-yl)-pyridin-2-yl]-4-pyridin-3-yl-2H-phthalazin-1-one hydrochloride ID: ALA537465
PubChem CID: 45263854
Max Phase: Preclinical
Molecular Formula: C33H29ClN4O5
Molecular Weight: 560.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cc2cc(CO)c(CO)c(-c3ccnc(-n4nc(-c5cccnc5)c5ccccc5c4=O)c3)c2cc1OC.Cl
Standard InChI: InChI=1S/C33H28N4O5.ClH/c1-3-42-29-14-22-13-23(18-38)27(19-39)31(26(22)16-28(29)41-2)20-10-12-35-30(15-20)37-33(40)25-9-5-4-8-24(25)32(36-37)21-7-6-11-34-17-21;/h4-17,38-39H,3,18-19H2,1-2H3;1H
Standard InChI Key: CAEUCPKDRSRQJR-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
7.1385 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.8165 -1.1786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8165 -2.0036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5310 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5310 -2.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3269 1.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1021 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6124 1.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2455 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2455 -2.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3269 2.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6124 0.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1021 1.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0413 1.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1021 0.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1021 2.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6124 2.9464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7558 1.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0413 2.9464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5310 -3.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7558 2.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6124 -1.1786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5310 0.0589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8165 -4.4786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3269 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4703 1.2964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4703 2.9464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8165 -3.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3269 0.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8165 1.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9600 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9600 -2.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8165 2.9464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5310 1.7089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8165 3.7714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2455 -3.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5310 -4.8911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1848 2.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1848 1.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2455 -4.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6744 -2.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6744 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8992 2.9464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 4 1 0
3 5 2 0
2 7 1 0
6 8 1 0
4 9 1 0
5 10 1 0
9 10 2 0
6 11 1 0
8 12 1 0
8 13 2 0
6 14 2 0
7 15 2 0
12 15 1 0
13 16 1 0
11 17 1 0
16 17 2 0
14 18 1 0
11 19 2 0
5 20 1 0
18 21 2 0
19 21 1 0
7 22 1 0
4 23 2 0
22 25 2 0
18 26 1 0
21 27 1 0
20 28 1 0
24 28 2 0
12 29 2 0
25 29 1 0
13 30 1 0
9 31 1 0
10 32 1 0
16 33 1 0
30 34 1 0
33 35 1 0
20 36 2 0
24 37 1 0
27 38 1 0
26 39 1 0
36 40 1 0
37 40 2 0
32 41 2 0
31 42 2 0
41 42 1 0
38 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 560.61Molecular Weight (Monoisotopic): 560.2060AlogP: 5.05#Rotatable Bonds: 8Polar Surface Area: 119.59Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.19CX LogP: 3.92CX LogD: 3.92Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.27Np Likeness Score: -0.55
References 1. Ukita T, Sugahara M, Terakawa Y, Kuroda T, Wada K, Nakata A, Ohmachi Y, Kikkawa H, Ikezawa K, Naito K.. (1999) Novel, potent, and selective phosphodiesterase-4 inhibitors as antiasthmatic agents: synthesis and biological activities of a series of 1-pyridylnaphthalene derivatives., 42 (6): [PMID:10090791 ] [10.1021/jm980314l ]