The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,4S,5S,7S)-7-(4-methoxy-3-(3-methoxypropoxy)benzyl)-5-amino-4-hydroxy-2,8-dimethyl-N-(4-(methylamino)-4-oxobutyl)nonanamide hydrochloride ID: ALA537668
PubChem CID: 23626575
Max Phase: Preclinical
Molecular Formula: C28H50ClN3O6
Molecular Weight: 523.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)CCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)C[C@H](Cc1ccc(OC)c(OCCCOC)c1)C(C)C.Cl
Standard InChI: InChI=1S/C28H49N3O6.ClH/c1-19(2)22(16-21-10-11-25(36-6)26(17-21)37-14-8-13-35-5)18-23(29)24(32)15-20(3)28(34)31-12-7-9-27(33)30-4;/h10-11,17,19-20,22-24,32H,7-9,12-16,18,29H2,1-6H3,(H,30,33)(H,31,34);1H/t20-,22+,23+,24+;/m1./s1
Standard InChI Key: RVLFDKRINKJMPX-QFUPZHBKSA-N
Molfile:
RDKit 2D
38 37 0 0 0 0 0 0 0 0999 V2000
7.6894 -7.1383 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2296 -5.4127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1872 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4854 -8.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4833 -9.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7815 -10.5188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4430 -10.3638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7793 -12.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0775 -12.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8509 -5.8560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2956 -3.7547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2952 -4.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2564 -3.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5257 -7.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5955 2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1877 -7.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0754 -14.2735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3736 -15.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3715 -16.5274 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.4139 -14.4284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.4095 -17.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
2 7 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 6
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
11 21 1 6
9 22 1 6
22 23 1 0
22 24 1 0
2 25 1 0
25 26 1 0
15 27 1 6
3 28 1 0
28 29 1 0
26 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
20 34 1 0
34 35 1 0
35 36 1 0
35 37 2 0
36 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.72Molecular Weight (Monoisotopic): 523.3621AlogP: 2.67#Rotatable Bonds: 19Polar Surface Area: 132.14Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.57CX LogP: 1.81CX LogD: -0.31Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: 0.05
References 1. Göschke R, Stutz S, Rasetti V, Cohen NC, Rahuel J, Rigollier P, Baum HP, Forgiarini P, Schnell CR, Wagner T, Gruetter MG, Fuhrer W, Schilling W, Cumin F, Wood JM, Maibaum J.. (2007) Novel 2,7-dialkyl-substituted 5(S)-amino-4(S)-hydroxy-8-phenyl-octanecarboxamide transition state peptidomimetics are potent and orally active inhibitors of human renin., 50 (20): [PMID:17824679 ] [10.1021/jm070314y ]