The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Phenyl-carbamic acid 2-[8-fluoro-5-(4-fluoro-phenyl)-1,3,4,4a,5,9b-hexahydro-pyrido[4,3-b]indol-2-yl]-ethyl ester hydrochloride ID: ALA538242
PubChem CID: 45264437
Max Phase: Preclinical
Molecular Formula: C26H26ClF2N3O2
Molecular Weight: 449.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=C(Nc1ccccc1)OCCN1CC[C@H]2[C@H](C1)c1cc(F)ccc1N2c1ccc(F)cc1
Standard InChI: InChI=1S/C26H25F2N3O2.ClH/c27-18-6-9-21(10-7-18)31-24-11-8-19(28)16-22(24)23-17-30(13-12-25(23)31)14-15-33-26(32)29-20-4-2-1-3-5-20;/h1-11,16,23,25H,12-15,17H2,(H,29,32);1H/t23-,25+;/m1./s1
Standard InChI Key: LZIXFYUNFGQDSI-BUDDBBPTSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
7.5335 -2.5224 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.3190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9014 0.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7006 0.8244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.2029 1.5620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.8991 -0.3854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7006 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2959 -3.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3021 -3.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6029 1.5671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0120 -5.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.5014 0.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3080 -5.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2900 -5.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7737 1.4291 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0167 -7.0197 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.0029 1.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3014 0.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.8033 1.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4959 -0.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7922 -1.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0995 0.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0940 -0.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9730 1.7915 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.2338 -1.6045 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 4 1 0
2 5 1 0
3 6 1 0
5 6 2 0
4 7 1 0
3 9 1 0
2 10 1 0
9 11 1 0
5 12 1 0
6 13 1 0
8 14 1 0
8 15 2 0
7 16 1 0
11 16 1 0
10 17 2 0
10 18 1 0
13 19 2 0
8 20 1 0
12 21 2 0
19 21 1 0
14 23 1 0
18 24 2 0
22 24 1 0
17 25 1 0
22 25 2 0
19 26 1 0
22 27 1 0
11 28 1 0
20 29 1 0
28 29 1 0
23 30 2 0
23 31 1 0
31 32 2 0
30 33 1 0
32 34 1 0
33 34 2 0
3 35 1 1
4 36 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.50Molecular Weight (Monoisotopic): 449.1915AlogP: 5.52#Rotatable Bonds: 5Polar Surface Area: 44.81Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.04CX Basic pKa: 7.22CX LogP: 5.25CX LogD: 5.03Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -1.30
References 1. Sarges R, Howard HR, Donahue KM, Welch WM, Dominy BW, Weissman A, Koe BK, Bordner J.. (1986) Neuroleptic activity of chiral trans-hexahydro-gamma-carbolines., 29 (1): [PMID:3941416 ] [10.1021/jm00151a002 ]