The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[2-(3-aminopropoxy)-3,5-dibromophenyl]-N-[2-(4-chlorophenyl)ethyl]-2-hydroxyiminopropanamide hydrochloride ID: ALA538576
Max Phase: Preclinical
Molecular Formula: C20H23Br2Cl2N3O3
Molecular Weight: 547.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.NCCCOc1c(Br)cc(Br)cc1C/C(=N/O)C(=O)NCCc1ccc(Cl)cc1
Standard InChI: InChI=1S/C20H22Br2ClN3O3.ClH/c21-15-10-14(19(17(22)12-15)29-9-1-7-24)11-18(26-28)20(27)25-8-6-13-2-4-16(23)5-3-13;/h2-5,10,12,28H,1,6-9,11,24H2,(H,25,27);1H/b26-18-;
Standard InChI Key: IGJVTLFRLSJUNT-ZVOSEVRTSA-N
Molfile:
RDKit 2D
30 30 0 0 0 0 0 0 0 0999 V2000
5.0987 -2.2494 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6078 -5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6103 -7.1988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 -0.7410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 0.7553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9299 1.3599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0990 -0.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4003 -1.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6994 -0.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9984 -1.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9984 -2.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6994 -3.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4004 -2.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 -1.3500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-14.0377 -3.5842 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
2 7 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
6 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
14 18 2 0
18 19 1 0
16 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
22 27 1 0
26 27 2 0
2 28 1 0
4 29 1 0
25 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.68Molecular Weight (Monoisotopic): 544.9716AlogP: 4.32#Rotatable Bonds: 10Polar Surface Area: 96.94Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.41CX Basic pKa: 9.95CX LogP: 3.55CX LogD: 2.66Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.18Np Likeness Score: -0.16
References 1. Zhu G, Yang F, Balachandran R, Höök P, Vallee RB, Curran DP, Day BW.. (2006) Synthesis and biological evaluation of purealin and analogues as cytoplasmic dynein heavy chain inhibitors., 49 (6): [PMID:16539395 ] [10.1021/jm051030l ]