Bis-(4-fluoro-phenyl)-piperidin-4-yl-amine hydrochloride

ID: ALA538990

PubChem CID: 45264268

Max Phase: Preclinical

Molecular Formula: C17H19ClF2N2

Molecular Weight: 288.34

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.Fc1ccc(N(c2ccc(F)cc2)C2CCNCC2)cc1

Standard InChI:  InChI=1S/C17H18F2N2.ClH/c18-13-1-5-15(6-2-13)21(17-9-11-20-12-10-17)16-7-3-14(19)4-8-16;/h1-8,17,20H,9-12H2;1H

Standard InChI Key:  GVFPNVADSOWHCE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
    4.5188    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.1361    0.0786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1361   -0.7464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5784    0.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2795    1.3161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8506    0.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2929    0.0786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5784    1.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8506   -1.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5784   -1.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0073    1.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1361   -2.3964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2929    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5784   -1.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0073    0.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8506   -1.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5650    0.0786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8506    1.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1361   -3.2214    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7218    1.7286    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2795    0.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5650    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  2  4  1  0
  2  6  1  0
  4  7  2  0
  4  8  1  0
  3  9  2  0
  3 10  1  0
  8 13  2  0
 11 13  1  0
 10 14  2  0
 12 14  1  0
  7 15  1  0
 11 15  2  0
  9 16  1  0
 12 16  2  0
  6 17  1  0
  6 18  1  0
 12 19  1  0
 11 20  1  0
  5 21  1  0
 17 21  1  0
  5 22  1  0
 18 22  1  0
M  END

Associated Targets(non-human)

Drd5 Dopamine receptor (1304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 288.34Molecular Weight (Monoisotopic): 288.1438AlogP: 3.85#Rotatable Bonds: 3
Polar Surface Area: 15.27Molecular Species: BASEHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.78CX LogP: 3.57CX LogD: 1.24
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.92Np Likeness Score: -0.59

References

1. Sarges R, Howard HR, Donahue KM, Welch WM, Dominy BW, Weissman A, Koe BK, Bordner J..  (1986)  Neuroleptic activity of chiral trans-hexahydro-gamma-carbolines.,  29  (1): [PMID:3941416] [10.1021/jm00151a002]

Source